About methyl 5-[(1-amino-2,4-dimethylpentan-2-yl)sulfamoyl]furan-2-carboxylate;hydrochloride
methyl 5-[(1-amino-2,4-dimethylpentan-2-yl)sulfamoyl]furan-2-carboxylate;hydrochloride (PubChem CID 119985233) has the molecular formula C13H23ClN2O5S
and a molecular weight of 354.86 g/mol. Its IUPAC name is methyl 5-[(1-amino-2,4-dimethylpentan-2-yl)sulfamoyl]furan-2-carboxylate;hydrochloride.
Molecular Properties
| Compound Name | methyl 5-[(1-amino-2,4-dimethylpentan-2-yl)sulfamoyl]furan-2-carboxylate;hydrochloride |
| PubChem CID | 119985233 |
| Molecular Formula | C13H23ClN2O5S |
| Molecular Weight | 354.86 g/mol |
| Exact Mass | 354.10 |
| IUPAC Name | methyl 5-[(1-amino-2,4-dimethylpentan-2-yl)sulfamoyl]furan-2-carboxylate;hydrochloride |
| SMILES | COC(=O)c1ccc(S(=O)(=O)NC(C)(CN)CC(C)C)o1.Cl |
| InChI | InChI=1S/C13H22N2O5S.ClH/c1-9(2)7-13(3,8-14)15-21(17,18)11-6-5-10(20-11)12(16)19-4;/h5-6,9,15H,7-8,14H2,1-4H3;1H |
| InChIKey | IVABNIGGQLQGGW-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 111.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.86 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze methyl 5-[(1-amino-2,4-dimethylpentan-2-yl)sulfamoyl]furan-2-carboxylate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 5-[(1-amino-2,4-dimethylpentan-2-yl)sulfamoyl]furan-2-carboxylate;hydrochloride?
The IUPAC name of methyl 5-[(1-amino-2,4-dimethylpentan-2-yl)sulfamoyl]furan-2-carboxylate;hydrochloride (CID 119985233) is methyl 5-[(1-amino-2,4-dimethylpentan-2-yl)sulfamoyl]furan-2-carboxylate;hydrochloride.
What is the SMILES notation for methyl 5-[(1-amino-2,4-dimethylpentan-2-yl)sulfamoyl]furan-2-carboxylate;hydrochloride?
The canonical SMILES for methyl 5-[(1-amino-2,4-dimethylpentan-2-yl)sulfamoyl]furan-2-carboxylate;hydrochloride is COC(=O)c1ccc(S(=O)(=O)NC(C)(CN)CC(C)C)o1.Cl.
What is the InChIKey of methyl 5-[(1-amino-2,4-dimethylpentan-2-yl)sulfamoyl]furan-2-carboxylate;hydrochloride?
The InChIKey is IVABNIGGQLQGGW-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22N2O5S.ClH/c1-9(2)7-13(3,8-14)15-21(17,18)11-6-5-10(20-11)12(16)19-4;/h5-6,9,15H,7-8,14H2,1-4H3;1H.
What are the key properties of methyl 5-[(1-amino-2,4-dimethylpentan-2-yl)sulfamoyl]furan-2-carboxylate;hydrochloride?
methyl 5-[(1-amino-2,4-dimethylpentan-2-yl)sulfamoyl]furan-2-carboxylate;hydrochloride has a molecular weight of 354.86 g/mol, XLogP of 1.53, 7 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-[(1-amino-2,4-dimethylpentan-2-yl)sulfamoyl]furan-2-carboxylate;hydrochloride is sourced from PubChem (CID 119985233), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).