C29H23F6NO4 — CID 11998587
4'-[3,5-bis(trifluoromethyl)phenyl]-1'-pentylspiro[6H-furo[2,3-f][1,3]benzodioxole-7,3'-indole]-2'-one (PubChem CID 11998587) has the molecular formula C29H23F6NO4 and a molecular weight of 563.49 g/mol. Its IUPAC name is 4'-[3,5-bis(trifluoromethyl)phenyl]-1'-pentylspiro[6H-furo[2,3-f][1,3]benzodioxole-7,3'-indole]-2'-one.
| Compound Name | 4'-[3,5-bis(trifluoromethyl)phenyl]-1'-pentylspiro[6H-furo[2,3-f][1,3]benzodioxole-7,3'-indole]-2'-one |
|---|---|
| PubChem CID | 11998587 |
| Molecular Formula | C29H23F6NO4 |
| Molecular Weight | 563.49 g/mol |
| Exact Mass | 563.15 |
| IUPAC Name | 4'-[3,5-bis(trifluoromethyl)phenyl]-1'-pentylspiro[6H-furo[2,3-f][1,3]benzodioxole-7,3'-indole]-2'-one |
| SMILES | CCCCCN1C(=O)C2(COc3cc4c(cc32)OCO4)c2c(-c3cc(C(F)(F)F)cc(C(F)(F)F)c3)cccc21 |
| InChI | InChI=1S/C29H23F6NO4/c1-2-3-4-8-36-21-7-5-6-19(16-9-17(28(30,31)32)11-18(10-16)29(33,34)35)25(21)27(26(36)37)14-38-22-13-24-23(12-20(22)27)39-15-40-24/h5-7,9-13H,2-4,8,14-15H2,1H3 |
| InChIKey | QJXSPFKYAYUCTH-UHFFFAOYSA-N |
| XLogP | 7.34 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.49 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|