C13H20Cl2N2O2S — CID 119986050
N-[2-(aminomethyl)cyclohexyl]-4-chlorobenzenesulfonamide;hydrochloride (PubChem CID 119986050) has the molecular formula C13H20Cl2N2O2S and a molecular weight of 339.29 g/mol. Its IUPAC name is N-[2-(aminomethyl)cyclohexyl]-4-chlorobenzenesulfonamide;hydrochloride.
| Compound Name | N-[2-(aminomethyl)cyclohexyl]-4-chlorobenzenesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 119986050 |
| Molecular Formula | C13H20Cl2N2O2S |
| Molecular Weight | 339.29 g/mol |
| Exact Mass | 338.06 |
| IUPAC Name | N-[2-(aminomethyl)cyclohexyl]-4-chlorobenzenesulfonamide;hydrochloride |
| SMILES | Cl.NCC1CCCCC1NS(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C13H19ClN2O2S.ClH/c14-11-5-7-12(8-6-11)19(17,18)16-13-4-2-1-3-10(13)9-15;/h5-8,10,13,16H,1-4,9,15H2;1H |
| InChIKey | OFPHXRGMRKNOLU-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.29 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |