C29H26FNO4 — CID 11998706
4'-[(E)-2-(4-fluorophenyl)ethenyl]-1'-pentylspiro[6H-furo[2,3-f][1,3]benzodioxole-7,3'-indole]-2'-one (PubChem CID 11998706) has the molecular formula C29H26FNO4 and a molecular weight of 471.53 g/mol. Its IUPAC name is 4'-[(E)-2-(4-fluorophenyl)ethenyl]-1'-pentylspiro[6H-furo[2,3-f][1,3]benzodioxole-7,3'-indole]-2'-one.
| Compound Name | 4'-[(E)-2-(4-fluorophenyl)ethenyl]-1'-pentylspiro[6H-furo[2,3-f][1,3]benzodioxole-7,3'-indole]-2'-one |
|---|---|
| PubChem CID | 11998706 |
| Molecular Formula | C29H26FNO4 |
| Molecular Weight | 471.53 g/mol |
| Exact Mass | 471.18 |
| IUPAC Name | 4'-[(E)-2-(4-fluorophenyl)ethenyl]-1'-pentylspiro[6H-furo[2,3-f][1,3]benzodioxole-7,3'-indole]-2'-one |
| SMILES | CCCCCN1C(=O)C2(COc3cc4c(cc32)OCO4)c2c(/C=C/c3ccc(F)cc3)cccc21 |
| InChI | InChI=1S/C29H26FNO4/c1-2-3-4-14-31-23-7-5-6-20(11-8-19-9-12-21(30)13-10-19)27(23)29(28(31)32)17-33-24-16-26-25(15-22(24)29)34-18-35-26/h5-13,15-16H,2-4,14,17-18H2,1H3/b11-8+ |
| InChIKey | HYJSXMVKPXUMEX-DHZHZOJOSA-N |
| XLogP | 5.94 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.53 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|