About N-[5-[5-(3-hydroxypropylsulfamoyl)thiophen-3-yl]-4-methyl-1,3-thiazol-2-yl]acetamide
N-[5-[5-(3-hydroxypropylsulfamoyl)thiophen-3-yl]-4-methyl-1,3-thiazol-2-yl]acetamide (PubChem CID 11998792) has the molecular formula C13H17N3O4S3
and a molecular weight of 375.50 g/mol. Its IUPAC name is N-[5-[5-(3-hydroxypropylsulfamoyl)thiophen-3-yl]-4-methyl-1,3-thiazol-2-yl]acetamide.
Molecular Properties
| Compound Name | N-[5-[5-(3-hydroxypropylsulfamoyl)thiophen-3-yl]-4-methyl-1,3-thiazol-2-yl]acetamide |
| PubChem CID | 11998792 |
| Molecular Formula | C13H17N3O4S3 |
| Molecular Weight | 375.50 g/mol |
| Exact Mass | 375.04 |
| IUPAC Name | N-[5-[5-(3-hydroxypropylsulfamoyl)thiophen-3-yl]-4-methyl-1,3-thiazol-2-yl]acetamide |
| SMILES | CC(=O)Nc1nc(C)c(-c2csc(S(=O)(=O)NCCCO)c2)s1 |
| InChI | InChI=1S/C13H17N3O4S3/c1-8-12(22-13(15-8)16-9(2)18)10-6-11(21-7-10)23(19,20)14-4-3-5-17/h6-7,14,17H,3-5H2,1-2H3,(H,15,16,18) |
| InChIKey | ZVJMGJMOUOTRPV-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 108.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 375.50 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-[5-[5-(3-hydroxypropylsulfamoyl)thiophen-3-yl]-4-methyl-1,3-thiazol-2-yl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[5-[5-(3-hydroxypropylsulfamoyl)thiophen-3-yl]-4-methyl-1,3-thiazol-2-yl]acetamide?
The IUPAC name of N-[5-[5-(3-hydroxypropylsulfamoyl)thiophen-3-yl]-4-methyl-1,3-thiazol-2-yl]acetamide (CID 11998792) is N-[5-[5-(3-hydroxypropylsulfamoyl)thiophen-3-yl]-4-methyl-1,3-thiazol-2-yl]acetamide.
What is the SMILES notation for N-[5-[5-(3-hydroxypropylsulfamoyl)thiophen-3-yl]-4-methyl-1,3-thiazol-2-yl]acetamide?
The canonical SMILES for N-[5-[5-(3-hydroxypropylsulfamoyl)thiophen-3-yl]-4-methyl-1,3-thiazol-2-yl]acetamide is CC(=O)Nc1nc(C)c(-c2csc(S(=O)(=O)NCCCO)c2)s1.
What is the InChIKey of N-[5-[5-(3-hydroxypropylsulfamoyl)thiophen-3-yl]-4-methyl-1,3-thiazol-2-yl]acetamide?
The InChIKey is ZVJMGJMOUOTRPV-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17N3O4S3/c1-8-12(22-13(15-8)16-9(2)18)10-6-11(21-7-10)23(19,20)14-4-3-5-17/h6-7,14,17H,3-5H2,1-2H3,(H,15,16,18).
What are the key properties of N-[5-[5-(3-hydroxypropylsulfamoyl)thiophen-3-yl]-4-methyl-1,3-thiazol-2-yl]acetamide?
N-[5-[5-(3-hydroxypropylsulfamoyl)thiophen-3-yl]-4-methyl-1,3-thiazol-2-yl]acetamide has a molecular weight of 375.50 g/mol, XLogP of 1.80, 7 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for N-[5-[5-(3-hydroxypropylsulfamoyl)thiophen-3-yl]-4-methyl-1,3-thiazol-2-yl]acetamide is sourced from PubChem (CID 11998792), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).