About N-[5-[5-(2-hydroxyethylsulfamoyl)thiophen-3-yl]-4-methyl-1,3-thiazol-2-yl]acetamide
N-[5-[5-(2-hydroxyethylsulfamoyl)thiophen-3-yl]-4-methyl-1,3-thiazol-2-yl]acetamide (PubChem CID 11998798) has the molecular formula C12H15N3O4S3
and a molecular weight of 361.47 g/mol. Its IUPAC name is N-[5-[5-(2-hydroxyethylsulfamoyl)thiophen-3-yl]-4-methyl-1,3-thiazol-2-yl]acetamide.
Molecular Properties
| Compound Name | N-[5-[5-(2-hydroxyethylsulfamoyl)thiophen-3-yl]-4-methyl-1,3-thiazol-2-yl]acetamide |
| PubChem CID | 11998798 |
| Molecular Formula | C12H15N3O4S3 |
| Molecular Weight | 361.47 g/mol |
| Exact Mass | 361.02 |
| IUPAC Name | N-[5-[5-(2-hydroxyethylsulfamoyl)thiophen-3-yl]-4-methyl-1,3-thiazol-2-yl]acetamide |
| SMILES | CC(=O)Nc1nc(C)c(-c2csc(S(=O)(=O)NCCO)c2)s1 |
| InChI | InChI=1S/C12H15N3O4S3/c1-7-11(21-12(14-7)15-8(2)17)9-5-10(20-6-9)22(18,19)13-3-4-16/h5-6,13,16H,3-4H2,1-2H3,(H,14,15,17) |
| InChIKey | VKWNHMSXZUXQBQ-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 108.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 361.47 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze N-[5-[5-(2-hydroxyethylsulfamoyl)thiophen-3-yl]-4-methyl-1,3-thiazol-2-yl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[5-[5-(2-hydroxyethylsulfamoyl)thiophen-3-yl]-4-methyl-1,3-thiazol-2-yl]acetamide?
The IUPAC name of N-[5-[5-(2-hydroxyethylsulfamoyl)thiophen-3-yl]-4-methyl-1,3-thiazol-2-yl]acetamide (CID 11998798) is N-[5-[5-(2-hydroxyethylsulfamoyl)thiophen-3-yl]-4-methyl-1,3-thiazol-2-yl]acetamide.
What is the SMILES notation for N-[5-[5-(2-hydroxyethylsulfamoyl)thiophen-3-yl]-4-methyl-1,3-thiazol-2-yl]acetamide?
The canonical SMILES for N-[5-[5-(2-hydroxyethylsulfamoyl)thiophen-3-yl]-4-methyl-1,3-thiazol-2-yl]acetamide is CC(=O)Nc1nc(C)c(-c2csc(S(=O)(=O)NCCO)c2)s1.
What is the InChIKey of N-[5-[5-(2-hydroxyethylsulfamoyl)thiophen-3-yl]-4-methyl-1,3-thiazol-2-yl]acetamide?
The InChIKey is VKWNHMSXZUXQBQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15N3O4S3/c1-7-11(21-12(14-7)15-8(2)17)9-5-10(20-6-9)22(18,19)13-3-4-16/h5-6,13,16H,3-4H2,1-2H3,(H,14,15,17).
What are the key properties of N-[5-[5-(2-hydroxyethylsulfamoyl)thiophen-3-yl]-4-methyl-1,3-thiazol-2-yl]acetamide?
N-[5-[5-(2-hydroxyethylsulfamoyl)thiophen-3-yl]-4-methyl-1,3-thiazol-2-yl]acetamide has a molecular weight of 361.47 g/mol, XLogP of 1.41, 6 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for N-[5-[5-(2-hydroxyethylsulfamoyl)thiophen-3-yl]-4-methyl-1,3-thiazol-2-yl]acetamide is sourced from PubChem (CID 11998798), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).