C21H21NO4 — CID 11998825
1'-pentylspiro[5H-furo[3,4-f][1,3]benzodioxole-7,3'-indole]-2'-one (PubChem CID 11998825) has the molecular formula C21H21NO4 and a molecular weight of 351.40 g/mol. Its IUPAC name is 1'-pentylspiro[5H-furo[3,4-f][1,3]benzodioxole-7,3'-indole]-2'-one.
| Compound Name | 1'-pentylspiro[5H-furo[3,4-f][1,3]benzodioxole-7,3'-indole]-2'-one |
|---|---|
| PubChem CID | 11998825 |
| Molecular Formula | C21H21NO4 |
| Molecular Weight | 351.40 g/mol |
| Exact Mass | 351.15 |
| IUPAC Name | 1'-pentylspiro[5H-furo[3,4-f][1,3]benzodioxole-7,3'-indole]-2'-one |
| SMILES | CCCCCN1C(=O)C2(OCc3cc4c(cc32)OCO4)c2ccccc21 |
| InChI | InChI=1S/C21H21NO4/c1-2-3-6-9-22-17-8-5-4-7-15(17)21(20(22)23)16-11-19-18(24-13-25-19)10-14(16)12-26-21/h4-5,7-8,10-11H,2-3,6,9,12-13H2,1H3 |
| InChIKey | KTFHKMBXOMMQGS-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.40 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|