C11H15BrClN3O4S — CID 119988924
[1-(4-bromo-2-nitrophenyl)sulfonylpyrrolidin-2-yl]methanamine;hydrochloride (PubChem CID 119988924) has the molecular formula C11H15BrClN3O4S and a molecular weight of 400.68 g/mol. Its IUPAC name is [1-(4-bromo-2-nitrophenyl)sulfonylpyrrolidin-2-yl]methanamine;hydrochloride.
| Compound Name | [1-(4-bromo-2-nitrophenyl)sulfonylpyrrolidin-2-yl]methanamine;hydrochloride |
|---|---|
| PubChem CID | 119988924 |
| Molecular Formula | C11H15BrClN3O4S |
| Molecular Weight | 400.68 g/mol |
| Exact Mass | 398.97 |
| IUPAC Name | [1-(4-bromo-2-nitrophenyl)sulfonylpyrrolidin-2-yl]methanamine;hydrochloride |
| SMILES | Cl.NCC1CCCN1S(=O)(=O)c1ccc(Br)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C11H14BrN3O4S.ClH/c12-8-3-4-11(10(6-8)15(16)17)20(18,19)14-5-1-2-9(14)7-13;/h3-4,6,9H,1-2,5,7,13H2;1H |
| InChIKey | NQIKGJXLEVNYRZ-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 106.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.68 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|