C24H27N5O3S2 — CID 11998928
6-[[[4-[(E)-N-methoxy-C-(4-methoxy-1,3-benzothiazol-2-yl)carbonimidoyl]cyclohexyl]amino]methyl]-4H-pyrido[3,2-b][1,4]thiazin-3-one (PubChem CID 11998928) has the molecular formula C24H27N5O3S2 and a molecular weight of 497.65 g/mol. Its IUPAC name is 6-[[[4-[(E)-N-methoxy-C-(4-methoxy-1,3-benzothiazol-2-yl)carbonimidoyl]cyclohexyl]amino]methyl]-4H-pyrido[3,2-b][1,4]thiazin-3-one.
| Compound Name | 6-[[[4-[(E)-N-methoxy-C-(4-methoxy-1,3-benzothiazol-2-yl)carbonimidoyl]cyclohexyl]amino]methyl]-4H-pyrido[3,2-b][1,4]thiazin-3-one |
|---|---|
| PubChem CID | 11998928 |
| Molecular Formula | C24H27N5O3S2 |
| Molecular Weight | 497.65 g/mol |
| Exact Mass | 497.16 |
| IUPAC Name | 6-[[[4-[(E)-N-methoxy-C-(4-methoxy-1,3-benzothiazol-2-yl)carbonimidoyl]cyclohexyl]amino]methyl]-4H-pyrido[3,2-b][1,4]thiazin-3-one |
| SMILES | CO/N=C(/c1nc2c(OC)cccc2s1)C1CCC(NCc2ccc3c(n2)NC(=O)CS3)CC1 |
| InChI | InChI=1S/C24H27N5O3S2/c1-31-17-4-3-5-18-22(17)28-24(34-18)21(29-32-2)14-6-8-15(9-7-14)25-12-16-10-11-19-23(26-16)27-20(30)13-33-19/h3-5,10-11,14-15,25H,6-9,12-13H2,1-2H3,(H,26,27,30)/b29-21+ |
| InChIKey | RRGNSVBYKYVUFC-XHLNEMQHSA-N |
| XLogP | 4.44 |
| TPSA | 97.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.65 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|