C9H21FN2O2S — CID 119989710
N-(2-amino-2-ethylbutyl)-3-fluoropropane-1-sulfonamide (PubChem CID 119989710) has the molecular formula C9H21FN2O2S and a molecular weight of 240.34 g/mol. Its IUPAC name is N-(2-amino-2-ethylbutyl)-3-fluoropropane-1-sulfonamide.
| Compound Name | N-(2-amino-2-ethylbutyl)-3-fluoropropane-1-sulfonamide |
|---|---|
| PubChem CID | 119989710 |
| Molecular Formula | C9H21FN2O2S |
| Molecular Weight | 240.34 g/mol |
| Exact Mass | 240.13 |
| IUPAC Name | N-(2-amino-2-ethylbutyl)-3-fluoropropane-1-sulfonamide |
| SMILES | CCC(N)(CC)CNS(=O)(=O)CCCF |
| InChI | InChI=1S/C9H21FN2O2S/c1-3-9(11,4-2)8-12-15(13,14)7-5-6-10/h12H,3-8,11H2,1-2H3 |
| InChIKey | JTLPCFYVUUDHPO-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.34 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |