C38H47F4N2O8S2+ — CID 11999027
6-[2-[(1E,3E,5E)-5-[4,6-difluoro-3-methyl-1,3-bis(4-sulfobutyl)indol-2-ylidene]penta-1,3-dienyl]-4,6-difluoro-3,3-dimethylindol-1-ium-1-yl]hexanoic acid (PubChem CID 11999027) has the molecular formula C38H47F4N2O8S2+ and a molecular weight of 799.93 g/mol. Its IUPAC name is 6-[2-[(1E,3E,5E)-5-[4,6-difluoro-3-methyl-1,3-bis(4-sulfobutyl)indol-2-ylidene]penta-1,3-dienyl]-4,6-difluoro-3,3-dimethylindol-1-ium-1-yl]hexanoic acid.
| Compound Name | 6-[2-[(1E,3E,5E)-5-[4,6-difluoro-3-methyl-1,3-bis(4-sulfobutyl)indol-2-ylidene]penta-1,3-dienyl]-4,6-difluoro-3,3-dimethylindol-1-ium-1-yl]hexanoic acid |
|---|---|
| PubChem CID | 11999027 |
| Molecular Formula | C38H47F4N2O8S2+ |
| Molecular Weight | 799.93 g/mol |
| Exact Mass | 799.27 |
| IUPAC Name | 6-[2-[(1E,3E,5E)-5-[4,6-difluoro-3-methyl-1,3-bis(4-sulfobutyl)indol-2-ylidene]penta-1,3-dienyl]-4,6-difluoro-3,3-dimethylindol-1-ium-1-yl]hexanoic acid |
| SMILES | CC1(C)C(/C=C/C=C/C=C2/N(CCCCS(=O)(=O)O)c3cc(F)cc(F)c3C2(C)CCCCS(=O)(=O)O)=[N+](CCCCCC(=O)O)c2cc(F)cc(F)c21 |
| InChI | InChI=1S/C38H46F4N2O8S2/c1-37(2)32(43(18-10-5-8-16-34(45)46)30-24-26(39)22-28(41)35(30)37)14-6-4-7-15-33-38(3,17-9-12-20-53(47,48)49)36-29(42)23-27(40)25-31(36)44(33)19-11-13-21-54(50,51)52/h4,6-7,14-15,22-25H,5,8-13,16-21H2,1-3H3,(H2-,45,46,47,48,49,50,51,52)/p+1 |
| InChIKey | RTLHYUFOWMEFMV-UHFFFAOYSA-O |
| XLogP | 7.76 |
| TPSA | 152.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 799.93 |
| LogP ≤ 5 | 7.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|