About 4-(4-fluorophenyl)-1,1-dimethyl-5-(4-methylsulfonylphenyl)-2,3-dihydrosilole
4-(4-fluorophenyl)-1,1-dimethyl-5-(4-methylsulfonylphenyl)-2,3-dihydrosilole (PubChem CID 11999132) has the molecular formula C19H21FO2SSi
and a molecular weight of 360.53 g/mol. Its IUPAC name is 4-(4-fluorophenyl)-1,1-dimethyl-5-(4-methylsulfonylphenyl)-2,3-dihydrosilole.
Molecular Properties
| Compound Name | 4-(4-fluorophenyl)-1,1-dimethyl-5-(4-methylsulfonylphenyl)-2,3-dihydrosilole |
| PubChem CID | 11999132 |
| Molecular Formula | C19H21FO2SSi |
| Molecular Weight | 360.53 g/mol |
| Exact Mass | 360.10 |
| IUPAC Name | 4-(4-fluorophenyl)-1,1-dimethyl-5-(4-methylsulfonylphenyl)-2,3-dihydrosilole |
| SMILES | C[Si]1(C)CCC(c2ccc(F)cc2)=C1c1ccc(S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C19H21FO2SSi/c1-23(21,22)17-10-6-15(7-11-17)19-18(12-13-24(19,2)3)14-4-8-16(20)9-5-14/h4-11H,12-13H2,1-3H3 |
| InChIKey | FSOZTSXLCIEDTP-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 360.53 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze 4-(4-fluorophenyl)-1,1-dimethyl-5-(4-methylsulfonylphenyl)-2,3-dihydrosilole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-fluorophenyl)-1,1-dimethyl-5-(4-methylsulfonylphenyl)-2,3-dihydrosilole?
The IUPAC name of 4-(4-fluorophenyl)-1,1-dimethyl-5-(4-methylsulfonylphenyl)-2,3-dihydrosilole (CID 11999132) is 4-(4-fluorophenyl)-1,1-dimethyl-5-(4-methylsulfonylphenyl)-2,3-dihydrosilole.
What is the SMILES notation for 4-(4-fluorophenyl)-1,1-dimethyl-5-(4-methylsulfonylphenyl)-2,3-dihydrosilole?
The canonical SMILES for 4-(4-fluorophenyl)-1,1-dimethyl-5-(4-methylsulfonylphenyl)-2,3-dihydrosilole is C[Si]1(C)CCC(c2ccc(F)cc2)=C1c1ccc(S(C)(=O)=O)cc1.
What is the InChIKey of 4-(4-fluorophenyl)-1,1-dimethyl-5-(4-methylsulfonylphenyl)-2,3-dihydrosilole?
The InChIKey is FSOZTSXLCIEDTP-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H21FO2SSi/c1-23(21,22)17-10-6-15(7-11-17)19-18(12-13-24(19,2)3)14-4-8-16(20)9-5-14/h4-11H,12-13H2,1-3H3.
What are the key properties of 4-(4-fluorophenyl)-1,1-dimethyl-5-(4-methylsulfonylphenyl)-2,3-dihydrosilole?
4-(4-fluorophenyl)-1,1-dimethyl-5-(4-methylsulfonylphenyl)-2,3-dihydrosilole has a molecular weight of 360.53 g/mol, XLogP of 4.79, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-fluorophenyl)-1,1-dimethyl-5-(4-methylsulfonylphenyl)-2,3-dihydrosilole is sourced from PubChem (CID 11999132), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).