C19H21FO2SSi — CID 11999133
3-(4-fluorophenyl)-1,1-dimethyl-4-(4-methylsulfonylphenyl)-2,5-dihydrosilole (PubChem CID 11999133) has the molecular formula C19H21FO2SSi and a molecular weight of 360.53 g/mol. Its IUPAC name is 3-(4-fluorophenyl)-1,1-dimethyl-4-(4-methylsulfonylphenyl)-2,5-dihydrosilole.
| Compound Name | 3-(4-fluorophenyl)-1,1-dimethyl-4-(4-methylsulfonylphenyl)-2,5-dihydrosilole |
|---|---|
| PubChem CID | 11999133 |
| Molecular Formula | C19H21FO2SSi |
| Molecular Weight | 360.53 g/mol |
| Exact Mass | 360.10 |
| IUPAC Name | 3-(4-fluorophenyl)-1,1-dimethyl-4-(4-methylsulfonylphenyl)-2,5-dihydrosilole |
| SMILES | C[Si]1(C)CC(c2ccc(F)cc2)=C(c2ccc(S(C)(=O)=O)cc2)C1 |
| InChI | InChI=1S/C19H21FO2SSi/c1-23(21,22)17-10-6-15(7-11-17)19-13-24(2,3)12-18(19)14-4-8-16(20)9-5-14/h4-11H,12-13H2,1-3H3 |
| InChIKey | KCZIXWRWJFDKCS-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.53 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|