About 4-[(3-amino-2,2-dimethylpropyl)-methylsulfamoyl]benzamide;hydrochloride
4-[(3-amino-2,2-dimethylpropyl)-methylsulfamoyl]benzamide;hydrochloride (PubChem CID 119991586) has the molecular formula C13H22ClN3O3S
and a molecular weight of 335.86 g/mol. Its IUPAC name is 4-[(3-amino-2,2-dimethylpropyl)-methylsulfamoyl]benzamide;hydrochloride.
Molecular Properties
| Compound Name | 4-[(3-amino-2,2-dimethylpropyl)-methylsulfamoyl]benzamide;hydrochloride |
| PubChem CID | 119991586 |
| Molecular Formula | C13H22ClN3O3S |
| Molecular Weight | 335.86 g/mol |
| Exact Mass | 335.11 |
| IUPAC Name | 4-[(3-amino-2,2-dimethylpropyl)-methylsulfamoyl]benzamide;hydrochloride |
| SMILES | CN(CC(C)(C)CN)S(=O)(=O)c1ccc(C(N)=O)cc1.Cl |
| InChI | InChI=1S/C13H21N3O3S.ClH/c1-13(2,8-14)9-16(3)20(18,19)11-6-4-10(5-7-11)12(15)17;/h4-7H,8-9,14H2,1-3H3,(H2,15,17);1H |
| InChIKey | SPCRFOSRCZAEHM-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 106.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.86 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[(3-amino-2,2-dimethylpropyl)-methylsulfamoyl]benzamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(3-amino-2,2-dimethylpropyl)-methylsulfamoyl]benzamide;hydrochloride?
The IUPAC name of 4-[(3-amino-2,2-dimethylpropyl)-methylsulfamoyl]benzamide;hydrochloride (CID 119991586) is 4-[(3-amino-2,2-dimethylpropyl)-methylsulfamoyl]benzamide;hydrochloride.
What is the SMILES notation for 4-[(3-amino-2,2-dimethylpropyl)-methylsulfamoyl]benzamide;hydrochloride?
The canonical SMILES for 4-[(3-amino-2,2-dimethylpropyl)-methylsulfamoyl]benzamide;hydrochloride is CN(CC(C)(C)CN)S(=O)(=O)c1ccc(C(N)=O)cc1.Cl.
What is the InChIKey of 4-[(3-amino-2,2-dimethylpropyl)-methylsulfamoyl]benzamide;hydrochloride?
The InChIKey is SPCRFOSRCZAEHM-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H21N3O3S.ClH/c1-13(2,8-14)9-16(3)20(18,19)11-6-4-10(5-7-11)12(15)17;/h4-7H,8-9,14H2,1-3H3,(H2,15,17);1H.
What are the key properties of 4-[(3-amino-2,2-dimethylpropyl)-methylsulfamoyl]benzamide;hydrochloride?
4-[(3-amino-2,2-dimethylpropyl)-methylsulfamoyl]benzamide;hydrochloride has a molecular weight of 335.86 g/mol, XLogP of 0.81, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(3-amino-2,2-dimethylpropyl)-methylsulfamoyl]benzamide;hydrochloride is sourced from PubChem (CID 119991586), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).