C15H24ClN3O2S — CID 119992112
N-(3-amino-4-methylpentyl)-1-(3-cyanophenyl)-N-methylmethanesulfonamide;hydrochloride (PubChem CID 119992112) has the molecular formula C15H24ClN3O2S and a molecular weight of 345.90 g/mol. Its IUPAC name is N-(3-amino-4-methylpentyl)-1-(3-cyanophenyl)-N-methylmethanesulfonamide;hydrochloride.
| Compound Name | N-(3-amino-4-methylpentyl)-1-(3-cyanophenyl)-N-methylmethanesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 119992112 |
| Molecular Formula | C15H24ClN3O2S |
| Molecular Weight | 345.90 g/mol |
| Exact Mass | 345.13 |
| IUPAC Name | N-(3-amino-4-methylpentyl)-1-(3-cyanophenyl)-N-methylmethanesulfonamide;hydrochloride |
| SMILES | CC(C)C(N)CCN(C)S(=O)(=O)Cc1cccc(C#N)c1.Cl |
| InChI | InChI=1S/C15H23N3O2S.ClH/c1-12(2)15(17)7-8-18(3)21(19,20)11-14-6-4-5-13(9-14)10-16;/h4-6,9,12,15H,7-8,11,17H2,1-3H3;1H |
| InChIKey | GDRMWHSPTDDDHV-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 87.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.90 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |