C14H31ClN2O2S — CID 119992202
N-(3-amino-4-methylpentyl)-1-cyclohexyl-N-methylmethanesulfonamide;hydrochloride (PubChem CID 119992202) has the molecular formula C14H31ClN2O2S and a molecular weight of 326.93 g/mol. Its IUPAC name is N-(3-amino-4-methylpentyl)-1-cyclohexyl-N-methylmethanesulfonamide;hydrochloride.
| Compound Name | N-(3-amino-4-methylpentyl)-1-cyclohexyl-N-methylmethanesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 119992202 |
| Molecular Formula | C14H31ClN2O2S |
| Molecular Weight | 326.93 g/mol |
| Exact Mass | 326.18 |
| IUPAC Name | N-(3-amino-4-methylpentyl)-1-cyclohexyl-N-methylmethanesulfonamide;hydrochloride |
| SMILES | CC(C)C(N)CCN(C)S(=O)(=O)CC1CCCCC1.Cl |
| InChI | InChI=1S/C14H30N2O2S.ClH/c1-12(2)14(15)9-10-16(3)19(17,18)11-13-7-5-4-6-8-13;/h12-14H,4-11,15H2,1-3H3;1H |
| InChIKey | CKXFIHXRZBJDME-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.93 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |