C37H37BrCl2N4O6S — CID 11999548
2-[2-amino-3-(4-bromobenzoyl)phenyl]acetic acid;2-(1-methyl-4-nitrososulfanylpiperidin-4-yl)ethyl 2-[2-(2,6-dichloroanilino)phenyl]acetate (PubChem CID 11999548) has the molecular formula C37H37BrCl2N4O6S and a molecular weight of 816.60 g/mol. Its IUPAC name is 2-[2-amino-3-(4-bromobenzoyl)phenyl]acetic acid;2-(1-methyl-4-nitrososulfanylpiperidin-4-yl)ethyl 2-[2-(2,6-dichloroanilino)phenyl]acetate.
| Compound Name | 2-[2-amino-3-(4-bromobenzoyl)phenyl]acetic acid;2-(1-methyl-4-nitrososulfanylpiperidin-4-yl)ethyl 2-[2-(2,6-dichloroanilino)phenyl]acetate |
|---|---|
| PubChem CID | 11999548 |
| Molecular Formula | C37H37BrCl2N4O6S |
| Molecular Weight | 816.60 g/mol |
| Exact Mass | 814.10 |
| IUPAC Name | 2-[2-amino-3-(4-bromobenzoyl)phenyl]acetic acid;2-(1-methyl-4-nitrososulfanylpiperidin-4-yl)ethyl 2-[2-(2,6-dichloroanilino)phenyl]acetate |
| SMILES | CN1CCC(CCOC(=O)Cc2ccccc2Nc2c(Cl)cccc2Cl)(SN=O)CC1.Nc1c(CC(=O)O)cccc1C(=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C22H25Cl2N3O3S.C15H12BrNO3/c1-27-12-9-22(10-13-27,31-26-29)11-14-30-20(28)15-16-5-2-3-8-19(16)25-21-17(23)6-4-7-18(21)24;16-11-6-4-9(5-7-11)15(20)12-3-1-2-10(14(12)17)8-13(18)19/h2-8,25H,9-15H2,1H3;1-7H,8,17H2,(H,18,19) |
| InChIKey | XPUGOLMPWDHCDB-UHFFFAOYSA-N |
| XLogP | 8.98 |
| TPSA | 151.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 816.60 |
| LogP ≤ 5 | 8.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|