C15H31ClN2O — CID 119996125
N-(3-amino-2-methylpropyl)-2-(cyclohexylmethyl)butanamide;hydrochloride (PubChem CID 119996125) has the molecular formula C15H31ClN2O and a molecular weight of 290.88 g/mol. Its IUPAC name is N-(3-amino-2-methylpropyl)-2-(cyclohexylmethyl)butanamide;hydrochloride.
| Compound Name | N-(3-amino-2-methylpropyl)-2-(cyclohexylmethyl)butanamide;hydrochloride |
|---|---|
| PubChem CID | 119996125 |
| Molecular Formula | C15H31ClN2O |
| Molecular Weight | 290.88 g/mol |
| Exact Mass | 290.21 |
| IUPAC Name | N-(3-amino-2-methylpropyl)-2-(cyclohexylmethyl)butanamide;hydrochloride |
| SMILES | CCC(CC1CCCCC1)C(=O)NCC(C)CN.Cl |
| InChI | InChI=1S/C15H30N2O.ClH/c1-3-14(9-13-7-5-4-6-8-13)15(18)17-11-12(2)10-16;/h12-14H,3-11,16H2,1-2H3,(H,17,18);1H |
| InChIKey | BGJRWAKDNDXWOK-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.88 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |