C15H19FN4O2 — CID 119996780
N-(3-amino-2-methylpropyl)-1-(4-fluoro-2-methylphenyl)-4-hydroxypyrazole-3-carboxamide (PubChem CID 119996780) has the molecular formula C15H19FN4O2 and a molecular weight of 306.34 g/mol. Its IUPAC name is N-(3-amino-2-methylpropyl)-1-(4-fluoro-2-methylphenyl)-4-hydroxypyrazole-3-carboxamide.
| Compound Name | N-(3-amino-2-methylpropyl)-1-(4-fluoro-2-methylphenyl)-4-hydroxypyrazole-3-carboxamide |
|---|---|
| PubChem CID | 119996780 |
| Molecular Formula | C15H19FN4O2 |
| Molecular Weight | 306.34 g/mol |
| Exact Mass | 306.15 |
| IUPAC Name | N-(3-amino-2-methylpropyl)-1-(4-fluoro-2-methylphenyl)-4-hydroxypyrazole-3-carboxamide |
| SMILES | Cc1cc(F)ccc1-n1cc(O)c(C(=O)NCC(C)CN)n1 |
| InChI | InChI=1S/C15H19FN4O2/c1-9(6-17)7-18-15(22)14-13(21)8-20(19-14)12-4-3-11(16)5-10(12)2/h3-5,8-9,21H,6-7,17H2,1-2H3,(H,18,22) |
| InChIKey | WAYNHJCQIXWSGJ-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 93.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.34 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |