C11H25ClN2O — CID 119998014
N-(3-amino-2-methylpropyl)-3-methylhexanamide;hydrochloride (PubChem CID 119998014) has the molecular formula C11H25ClN2O and a molecular weight of 236.79 g/mol. Its IUPAC name is N-(3-amino-2-methylpropyl)-3-methylhexanamide;hydrochloride.
| Compound Name | N-(3-amino-2-methylpropyl)-3-methylhexanamide;hydrochloride |
|---|---|
| PubChem CID | 119998014 |
| Molecular Formula | C11H25ClN2O |
| Molecular Weight | 236.79 g/mol |
| Exact Mass | 236.17 |
| IUPAC Name | N-(3-amino-2-methylpropyl)-3-methylhexanamide;hydrochloride |
| SMILES | CCCC(C)CC(=O)NCC(C)CN.Cl |
| InChI | InChI=1S/C11H24N2O.ClH/c1-4-5-9(2)6-11(14)13-8-10(3)7-12;/h9-10H,4-8,12H2,1-3H3,(H,13,14);1H |
| InChIKey | FPSYPFCQLFXOCV-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.79 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |