C13H27ClN2O3S — CID 119998562
N-[(1-aminocycloheptyl)methyl]-1-(oxolan-2-yl)methanesulfonamide;hydrochloride (PubChem CID 119998562) has the molecular formula C13H27ClN2O3S and a molecular weight of 326.89 g/mol. Its IUPAC name is N-[(1-aminocycloheptyl)methyl]-1-(oxolan-2-yl)methanesulfonamide;hydrochloride.
| Compound Name | N-[(1-aminocycloheptyl)methyl]-1-(oxolan-2-yl)methanesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 119998562 |
| Molecular Formula | C13H27ClN2O3S |
| Molecular Weight | 326.89 g/mol |
| Exact Mass | 326.14 |
| IUPAC Name | N-[(1-aminocycloheptyl)methyl]-1-(oxolan-2-yl)methanesulfonamide;hydrochloride |
| SMILES | Cl.NC1(CNS(=O)(=O)CC2CCCO2)CCCCCC1 |
| InChI | InChI=1S/C13H26N2O3S.ClH/c14-13(7-3-1-2-4-8-13)11-15-19(16,17)10-12-6-5-9-18-12;/h12,15H,1-11,14H2;1H |
| InChIKey | PATULAOSSUZYLH-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.89 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |