C16H25Cl2N3O — CID 119999315
(5-methyl-3-pyridinyl)-(4-pyrrolidin-2-ylpiperidin-1-yl)methanone;dihydrochloride (PubChem CID 119999315) has the molecular formula C16H25Cl2N3O and a molecular weight of 346.30 g/mol. Its IUPAC name is (5-methyl-3-pyridinyl)-(4-pyrrolidin-2-ylpiperidin-1-yl)methanone;dihydrochloride.
| Compound Name | (5-methyl-3-pyridinyl)-(4-pyrrolidin-2-ylpiperidin-1-yl)methanone;dihydrochloride |
|---|---|
| PubChem CID | 119999315 |
| Molecular Formula | C16H25Cl2N3O |
| Molecular Weight | 346.30 g/mol |
| Exact Mass | 345.14 |
| IUPAC Name | (5-methyl-3-pyridinyl)-(4-pyrrolidin-2-ylpiperidin-1-yl)methanone;dihydrochloride |
| SMILES | Cc1cncc(C(=O)N2CCC(C3CCCN3)CC2)c1.Cl.Cl |
| InChI | InChI=1S/C16H23N3O.2ClH/c1-12-9-14(11-17-10-12)16(20)19-7-4-13(5-8-19)15-3-2-6-18-15;;/h9-11,13,15,18H,2-8H2,1H3;2*1H |
| InChIKey | GRRYVBBWIMVDKB-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.30 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |