C23H22N2O10 — CID 12000431
[(2S,3R,4S,5S,6R)-4,5-dihydroxy-6-[(4-hydroxybenzoyl)oxymethyl]-2-(1H-pyrrole-2-carbonyloxy)oxan-3-yl] 1H-pyrrole-2-carboxylate (PubChem CID 12000431) has the molecular formula C23H22N2O10 and a molecular weight of 486.43 g/mol. Its IUPAC name is [(2S,3R,4S,5S,6R)-4,5-dihydroxy-6-[(4-hydroxybenzoyl)oxymethyl]-2-(1H-pyrrole-2-carbonyloxy)oxan-3-yl] 1H-pyrrole-2-carboxylate.
| Compound Name | [(2S,3R,4S,5S,6R)-4,5-dihydroxy-6-[(4-hydroxybenzoyl)oxymethyl]-2-(1H-pyrrole-2-carbonyloxy)oxan-3-yl] 1H-pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 12000431 |
| Molecular Formula | C23H22N2O10 |
| Molecular Weight | 486.43 g/mol |
| Exact Mass | 486.13 |
| IUPAC Name | [(2S,3R,4S,5S,6R)-4,5-dihydroxy-6-[(4-hydroxybenzoyl)oxymethyl]-2-(1H-pyrrole-2-carbonyloxy)oxan-3-yl] 1H-pyrrole-2-carboxylate |
| SMILES | O=C(OC[C@H]1O[C@@H](OC(=O)c2ccc[nH]2)[C@H](OC(=O)c2ccc[nH]2)[C@@H](O)[C@@H]1O)c1ccc(O)cc1 |
| InChI | InChI=1S/C23H22N2O10/c26-13-7-5-12(6-8-13)20(29)32-11-16-17(27)18(28)19(34-21(30)14-3-1-9-24-14)23(33-16)35-22(31)15-4-2-10-25-15/h1-10,16-19,23-28H,11H2/t16-,17-,18+,19-,23+/m1/s1 |
| InChIKey | COYDKDJYHPRCPT-YUWRVLAPSA-N |
| XLogP | 0.73 |
| TPSA | 180.40 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.43 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|