C17H17NO3 — CID 12000456
7-benzyl-4-ethyl-1,4-dihydropyrano[3,4-c]pyridine-3,8-dione (PubChem CID 12000456) has the molecular formula C17H17NO3 and a molecular weight of 283.33 g/mol. Its IUPAC name is 7-benzyl-4-ethyl-1,4-dihydropyrano[3,4-c]pyridine-3,8-dione.
| Compound Name | 7-benzyl-4-ethyl-1,4-dihydropyrano[3,4-c]pyridine-3,8-dione |
|---|---|
| PubChem CID | 12000456 |
| Molecular Formula | C17H17NO3 |
| Molecular Weight | 283.33 g/mol |
| Exact Mass | 283.12 |
| IUPAC Name | 7-benzyl-4-ethyl-1,4-dihydropyrano[3,4-c]pyridine-3,8-dione |
| SMILES | CCC1C(=O)OCc2c1ccn(Cc1ccccc1)c2=O |
| InChI | InChI=1S/C17H17NO3/c1-2-13-14-8-9-18(10-12-6-4-3-5-7-12)16(19)15(14)11-21-17(13)20/h3-9,13H,2,10-11H2,1H3 |
| InChIKey | DCQLCHMQCQHJBE-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 48.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.33 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |