About (4S)-7-benzyl-4-ethyl-4-hydroxy-1H-pyrano[3,4-c]pyridine-3,8-dione
(4S)-7-benzyl-4-ethyl-4-hydroxy-1H-pyrano[3,4-c]pyridine-3,8-dione (PubChem CID 12000503) has the molecular formula C17H17NO4
and a molecular weight of 299.33 g/mol. Its IUPAC name is (4S)-7-benzyl-4-ethyl-4-hydroxy-1H-pyrano[3,4-c]pyridine-3,8-dione.
Molecular Properties
| Compound Name | (4S)-7-benzyl-4-ethyl-4-hydroxy-1H-pyrano[3,4-c]pyridine-3,8-dione |
| PubChem CID | 12000503 |
| Molecular Formula | C17H17NO4 |
| Molecular Weight | 299.33 g/mol |
| Exact Mass | 299.12 |
| IUPAC Name | (4S)-7-benzyl-4-ethyl-4-hydroxy-1H-pyrano[3,4-c]pyridine-3,8-dione |
| SMILES | CC[C@@]1(O)C(=O)OCc2c1ccn(Cc1ccccc1)c2=O |
| InChI | InChI=1S/C17H17NO4/c1-2-17(21)14-8-9-18(10-12-6-4-3-5-7-12)15(19)13(14)11-22-16(17)20/h3-9,21H,2,10-11H2,1H3/t17-/m0/s1 |
| InChIKey | XCMCFMBSJFGVAS-KRWDZBQOSA-N |
| XLogP | 1.55 |
| TPSA | 68.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.33 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (4S)-7-benzyl-4-ethyl-4-hydroxy-1H-pyrano[3,4-c]pyridine-3,8-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S)-7-benzyl-4-ethyl-4-hydroxy-1H-pyrano[3,4-c]pyridine-3,8-dione?
The IUPAC name of (4S)-7-benzyl-4-ethyl-4-hydroxy-1H-pyrano[3,4-c]pyridine-3,8-dione (CID 12000503) is (4S)-7-benzyl-4-ethyl-4-hydroxy-1H-pyrano[3,4-c]pyridine-3,8-dione.
What is the SMILES notation for (4S)-7-benzyl-4-ethyl-4-hydroxy-1H-pyrano[3,4-c]pyridine-3,8-dione?
The canonical SMILES for (4S)-7-benzyl-4-ethyl-4-hydroxy-1H-pyrano[3,4-c]pyridine-3,8-dione is CC[C@@]1(O)C(=O)OCc2c1ccn(Cc1ccccc1)c2=O.
What is the InChIKey of (4S)-7-benzyl-4-ethyl-4-hydroxy-1H-pyrano[3,4-c]pyridine-3,8-dione?
The InChIKey is XCMCFMBSJFGVAS-KRWDZBQOSA-N. The full InChI is InChI=1S/C17H17NO4/c1-2-17(21)14-8-9-18(10-12-6-4-3-5-7-12)15(19)13(14)11-22-16(17)20/h3-9,21H,2,10-11H2,1H3/t17-/m0/s1.
What are the key properties of (4S)-7-benzyl-4-ethyl-4-hydroxy-1H-pyrano[3,4-c]pyridine-3,8-dione?
(4S)-7-benzyl-4-ethyl-4-hydroxy-1H-pyrano[3,4-c]pyridine-3,8-dione has a molecular weight of 299.33 g/mol, XLogP of 1.55, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (4S)-7-benzyl-4-ethyl-4-hydroxy-1H-pyrano[3,4-c]pyridine-3,8-dione is sourced from PubChem (CID 12000503), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).