C27H47IO3Si — CID 12000507
ethyl (2E,6E,10E,15E)-14-[tert-butyl(dimethyl)silyl]oxy-16-iodo-6,10,14-trimethylhexadeca-2,6,10,15-tetraenoate (PubChem CID 12000507) has the molecular formula C27H47IO3Si and a molecular weight of 574.66 g/mol. Its IUPAC name is ethyl (2E,6E,10E,15E)-14-[tert-butyl(dimethyl)silyl]oxy-16-iodo-6,10,14-trimethylhexadeca-2,6,10,15-tetraenoate.
| Compound Name | ethyl (2E,6E,10E,15E)-14-[tert-butyl(dimethyl)silyl]oxy-16-iodo-6,10,14-trimethylhexadeca-2,6,10,15-tetraenoate |
|---|---|
| PubChem CID | 12000507 |
| Molecular Formula | C27H47IO3Si |
| Molecular Weight | 574.66 g/mol |
| Exact Mass | 574.23 |
| IUPAC Name | ethyl (2E,6E,10E,15E)-14-[tert-butyl(dimethyl)silyl]oxy-16-iodo-6,10,14-trimethylhexadeca-2,6,10,15-tetraenoate |
| SMILES | CCOC(=O)/C=C/CC/C(C)=C/CC/C(C)=C/CCC(C)(/C=C/I)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C27H47IO3Si/c1-10-30-25(29)19-12-11-15-23(2)16-13-17-24(3)18-14-20-27(7,21-22-28)31-32(8,9)26(4,5)6/h12,16,18-19,21-22H,10-11,13-15,17,20H2,1-9H3/b19-12+,22-21+,23-16+,24-18+ |
| InChIKey | VVKKCHWYKZJPLI-UZZUUFRMSA-N |
| XLogP | 9.07 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.66 |
| LogP ≤ 5 | 9.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|