C27H46O3Si — CID 12000508
ethyl (2E)-2-[(2E,7E,11E)-4-[tert-butyl(dimethyl)silyl]oxy-4,8,12-trimethylcyclotetradeca-2,7,11-trien-1-ylidene]acetate (PubChem CID 12000508) has the molecular formula C27H46O3Si and a molecular weight of 446.75 g/mol. Its IUPAC name is ethyl (2E)-2-[(2E,7E,11E)-4-[tert-butyl(dimethyl)silyl]oxy-4,8,12-trimethylcyclotetradeca-2,7,11-trien-1-ylidene]acetate.
| Compound Name | ethyl (2E)-2-[(2E,7E,11E)-4-[tert-butyl(dimethyl)silyl]oxy-4,8,12-trimethylcyclotetradeca-2,7,11-trien-1-ylidene]acetate |
|---|---|
| PubChem CID | 12000508 |
| Molecular Formula | C27H46O3Si |
| Molecular Weight | 446.75 g/mol |
| Exact Mass | 446.32 |
| IUPAC Name | ethyl (2E)-2-[(2E,7E,11E)-4-[tert-butyl(dimethyl)silyl]oxy-4,8,12-trimethylcyclotetradeca-2,7,11-trien-1-ylidene]acetate |
| SMILES | CCOC(=O)/C=C1/C=C/C(C)(O[Si](C)(C)C(C)(C)C)CC/C=C(/C)CC/C=C(\C)CC1 |
| InChI | InChI=1S/C27H46O3Si/c1-10-29-25(28)21-24-17-16-23(3)14-11-13-22(2)15-12-19-27(7,20-18-24)30-31(8,9)26(4,5)6/h14-15,18,20-21H,10-13,16-17,19H2,1-9H3/b20-18+,22-15-,23-14+,24-21+ |
| InChIKey | UPTOFHJFRWMABB-KMFXCQJGSA-N |
| XLogP | 8.06 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.75 |
| LogP ≤ 5 | 8.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|