C23H40O2Si — CID 12000548
(4S,5S)-4-[(1S)-1-[tert-butyl(dimethyl)silyl]oxy-2-methylprop-2-enyl]-2-methyl-5-propan-2-yl-3-prop-2-enylcyclohex-2-en-1-one (PubChem CID 12000548) has the molecular formula C23H40O2Si and a molecular weight of 376.66 g/mol. Its IUPAC name is (4S,5S)-4-[(1S)-1-[tert-butyl(dimethyl)silyl]oxy-2-methylprop-2-enyl]-2-methyl-5-propan-2-yl-3-prop-2-enylcyclohex-2-en-1-one.
| Compound Name | (4S,5S)-4-[(1S)-1-[tert-butyl(dimethyl)silyl]oxy-2-methylprop-2-enyl]-2-methyl-5-propan-2-yl-3-prop-2-enylcyclohex-2-en-1-one |
|---|---|
| PubChem CID | 12000548 |
| Molecular Formula | C23H40O2Si |
| Molecular Weight | 376.66 g/mol |
| Exact Mass | 376.28 |
| IUPAC Name | (4S,5S)-4-[(1S)-1-[tert-butyl(dimethyl)silyl]oxy-2-methylprop-2-enyl]-2-methyl-5-propan-2-yl-3-prop-2-enylcyclohex-2-en-1-one |
| SMILES | C=CCC1=C(C)C(=O)C[C@@H](C(C)C)[C@@H]1[C@H](O[Si](C)(C)C(C)(C)C)C(=C)C |
| InChI | InChI=1S/C23H40O2Si/c1-12-13-18-17(6)20(24)14-19(15(2)3)21(18)22(16(4)5)25-26(10,11)23(7,8)9/h12,15,19,21-22H,1,4,13-14H2,2-3,5-11H3/t19-,21+,22+/m0/s1 |
| InChIKey | SNAJGBFZICAKNR-KSEOMHKRSA-N |
| XLogP | 6.71 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.66 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|