C23H37NO3Si — CID 12000560
[(2S,4S,9aR)-4-(3,4-dimethoxyphenyl)-2,3,4,6,9,9a-hexahydro-1H-quinolizin-2-yl]oxy-tert-butyl-dimethylsilane (PubChem CID 12000560) has the molecular formula C23H37NO3Si and a molecular weight of 403.64 g/mol. Its IUPAC name is [(2S,4S,9aR)-4-(3,4-dimethoxyphenyl)-2,3,4,6,9,9a-hexahydro-1H-quinolizin-2-yl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [(2S,4S,9aR)-4-(3,4-dimethoxyphenyl)-2,3,4,6,9,9a-hexahydro-1H-quinolizin-2-yl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 12000560 |
| Molecular Formula | C23H37NO3Si |
| Molecular Weight | 403.64 g/mol |
| Exact Mass | 403.25 |
| IUPAC Name | [(2S,4S,9aR)-4-(3,4-dimethoxyphenyl)-2,3,4,6,9,9a-hexahydro-1H-quinolizin-2-yl]oxy-tert-butyl-dimethylsilane |
| SMILES | COc1ccc([C@@H]2C[C@@H](O[Si](C)(C)C(C)(C)C)C[C@H]3CC=CCN32)cc1OC |
| InChI | InChI=1S/C23H37NO3Si/c1-23(2,3)28(6,7)27-19-15-18-10-8-9-13-24(18)20(16-19)17-11-12-21(25-4)22(14-17)26-5/h8-9,11-12,14,18-20H,10,13,15-16H2,1-7H3/t18-,19+,20+/m1/s1 |
| InChIKey | CDZWAXUMDJZRIR-AABGKKOBSA-N |
| XLogP | 5.56 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.64 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|