C17H34O3Si — CID 12000574
(5S,6S)-5-[tert-butyl(dimethyl)silyl]oxy-6,8-dimethylnon-8-enoic acid (PubChem CID 12000574) has the molecular formula C17H34O3Si and a molecular weight of 314.54 g/mol. Its IUPAC name is (5S,6S)-5-[tert-butyl(dimethyl)silyl]oxy-6,8-dimethylnon-8-enoic acid.
| Compound Name | (5S,6S)-5-[tert-butyl(dimethyl)silyl]oxy-6,8-dimethylnon-8-enoic acid |
|---|---|
| PubChem CID | 12000574 |
| Molecular Formula | C17H34O3Si |
| Molecular Weight | 314.54 g/mol |
| Exact Mass | 314.23 |
| IUPAC Name | (5S,6S)-5-[tert-butyl(dimethyl)silyl]oxy-6,8-dimethylnon-8-enoic acid |
| SMILES | C=C(C)C[C@H](C)[C@H](CCCC(=O)O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C17H34O3Si/c1-13(2)12-14(3)15(10-9-11-16(18)19)20-21(7,8)17(4,5)6/h14-15H,1,9-12H2,2-8H3,(H,18,19)/t14-,15-/m0/s1 |
| InChIKey | SFPAVUKZPXCCIX-GJZGRUSLSA-N |
| XLogP | 5.23 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.54 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|