C31H37N3O5 — CID 12000777
(4aS,8aR)-4-(3,4-dimethoxyphenyl)-2-[[4-(1,4-dioxa-8-azaspiro[4.5]decan-8-ylmethyl)phenyl]methyl]-4a,5,8,8a-tetrahydrophthalazin-1-one (PubChem CID 12000777) has the molecular formula C31H37N3O5 and a molecular weight of 531.65 g/mol. Its IUPAC name is (4aS,8aR)-4-(3,4-dimethoxyphenyl)-2-[[4-(1,4-dioxa-8-azaspiro[4.5]decan-8-ylmethyl)phenyl]methyl]-4a,5,8,8a-tetrahydrophthalazin-1-one.
| Compound Name | (4aS,8aR)-4-(3,4-dimethoxyphenyl)-2-[[4-(1,4-dioxa-8-azaspiro[4.5]decan-8-ylmethyl)phenyl]methyl]-4a,5,8,8a-tetrahydrophthalazin-1-one |
|---|---|
| PubChem CID | 12000777 |
| Molecular Formula | C31H37N3O5 |
| Molecular Weight | 531.65 g/mol |
| Exact Mass | 531.27 |
| IUPAC Name | (4aS,8aR)-4-(3,4-dimethoxyphenyl)-2-[[4-(1,4-dioxa-8-azaspiro[4.5]decan-8-ylmethyl)phenyl]methyl]-4a,5,8,8a-tetrahydrophthalazin-1-one |
| SMILES | COc1ccc(C2=NN(Cc3ccc(CN4CCC5(CC4)OCCO5)cc3)C(=O)[C@@H]3CC=CC[C@H]23)cc1OC |
| InChI | InChI=1S/C31H37N3O5/c1-36-27-12-11-24(19-28(27)37-2)29-25-5-3-4-6-26(25)30(35)34(32-29)21-23-9-7-22(8-10-23)20-33-15-13-31(14-16-33)38-17-18-39-31/h3-4,7-12,19,25-26H,5-6,13-18,20-21H2,1-2H3/t25-,26+/m0/s1 |
| InChIKey | OQGFHEKSYOZJBE-IZZNHLLZSA-N |
| XLogP | 4.37 |
| TPSA | 72.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.65 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|