C22H34O4 — CID 12000800
3-[[3-(2-methylhexan-2-yl)-5a,6,7,8,9,9a-hexahydrodibenzofuran-1-yl]oxy]propane-1,2-diol (PubChem CID 12000800) has the molecular formula C22H34O4 and a molecular weight of 362.51 g/mol. Its IUPAC name is 3-[[3-(2-methylhexan-2-yl)-5a,6,7,8,9,9a-hexahydrodibenzofuran-1-yl]oxy]propane-1,2-diol.
| Compound Name | 3-[[3-(2-methylhexan-2-yl)-5a,6,7,8,9,9a-hexahydrodibenzofuran-1-yl]oxy]propane-1,2-diol |
|---|---|
| PubChem CID | 12000800 |
| Molecular Formula | C22H34O4 |
| Molecular Weight | 362.51 g/mol |
| Exact Mass | 362.25 |
| IUPAC Name | 3-[[3-(2-methylhexan-2-yl)-5a,6,7,8,9,9a-hexahydrodibenzofuran-1-yl]oxy]propane-1,2-diol |
| SMILES | CCCCC(C)(C)c1cc(OCC(O)CO)c2c(c1)OC1CCCCC21 |
| InChI | InChI=1S/C22H34O4/c1-4-5-10-22(2,3)15-11-19(25-14-16(24)13-23)21-17-8-6-7-9-18(17)26-20(21)12-15/h11-12,16-18,23-24H,4-10,13-14H2,1-3H3 |
| InChIKey | DPDJOSWZRZBGKE-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.51 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |