C29H33N3O4 — CID 12000858
(4aS,8aR)-4-(3,4-dimethoxyphenyl)-2-[[4-[(4-oxopiperidin-1-yl)methyl]phenyl]methyl]-4a,5,8,8a-tetrahydrophthalazin-1-one (PubChem CID 12000858) has the molecular formula C29H33N3O4 and a molecular weight of 487.60 g/mol. Its IUPAC name is (4aS,8aR)-4-(3,4-dimethoxyphenyl)-2-[[4-[(4-oxopiperidin-1-yl)methyl]phenyl]methyl]-4a,5,8,8a-tetrahydrophthalazin-1-one.
| Compound Name | (4aS,8aR)-4-(3,4-dimethoxyphenyl)-2-[[4-[(4-oxopiperidin-1-yl)methyl]phenyl]methyl]-4a,5,8,8a-tetrahydrophthalazin-1-one |
|---|---|
| PubChem CID | 12000858 |
| Molecular Formula | C29H33N3O4 |
| Molecular Weight | 487.60 g/mol |
| Exact Mass | 487.25 |
| IUPAC Name | (4aS,8aR)-4-(3,4-dimethoxyphenyl)-2-[[4-[(4-oxopiperidin-1-yl)methyl]phenyl]methyl]-4a,5,8,8a-tetrahydrophthalazin-1-one |
| SMILES | COc1ccc(C2=NN(Cc3ccc(CN4CCC(=O)CC4)cc3)C(=O)[C@@H]3CC=CC[C@H]23)cc1OC |
| InChI | InChI=1S/C29H33N3O4/c1-35-26-12-11-22(17-27(26)36-2)28-24-5-3-4-6-25(24)29(34)32(30-28)19-21-9-7-20(8-10-21)18-31-15-13-23(33)14-16-31/h3-4,7-12,17,24-25H,5-6,13-16,18-19H2,1-2H3/t24-,25+/m0/s1 |
| InChIKey | ZQJQVLFFFPAOBV-LOSJGSFVSA-N |
| XLogP | 4.20 |
| TPSA | 71.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.60 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|