C38H54N6O — CID 12000999
2-[3-[(2S,5R)-1-[(2R)-2-amino-3-(2,4-dimethylphenyl)propyl]-5-(cyclohexylmethyl)-4-(2-naphthalen-2-ylacetyl)piperazin-2-yl]propyl]guanidine (PubChem CID 12000999) has the molecular formula C38H54N6O and a molecular weight of 610.89 g/mol. Its IUPAC name is 2-[3-[(2S,5R)-1-[(2R)-2-amino-3-(2,4-dimethylphenyl)propyl]-5-(cyclohexylmethyl)-4-(2-naphthalen-2-ylacetyl)piperazin-2-yl]propyl]guanidine.
| Compound Name | 2-[3-[(2S,5R)-1-[(2R)-2-amino-3-(2,4-dimethylphenyl)propyl]-5-(cyclohexylmethyl)-4-(2-naphthalen-2-ylacetyl)piperazin-2-yl]propyl]guanidine |
|---|---|
| PubChem CID | 12000999 |
| Molecular Formula | C38H54N6O |
| Molecular Weight | 610.89 g/mol |
| Exact Mass | 610.44 |
| IUPAC Name | 2-[3-[(2S,5R)-1-[(2R)-2-amino-3-(2,4-dimethylphenyl)propyl]-5-(cyclohexylmethyl)-4-(2-naphthalen-2-ylacetyl)piperazin-2-yl]propyl]guanidine |
| SMILES | Cc1ccc(C[C@@H](N)CN2C[C@@H](CC3CCCCC3)N(C(=O)Cc3ccc4ccccc4c3)C[C@@H]2CCCN=C(N)N)c(C)c1 |
| InChI | InChI=1S/C38H54N6O/c1-27-14-16-32(28(2)19-27)23-34(39)24-43-25-36(21-29-9-4-3-5-10-29)44(26-35(43)13-8-18-42-38(40)41)37(45)22-30-15-17-31-11-6-7-12-33(31)20-30/h6-7,11-12,14-17,19-20,29,34-36H,3-5,8-10,13,18,21-26,39H2,1-2H3,(H4,40,41,42)/t34-,35+,36-/m1/s1 |
| InChIKey | FZCCBZSXOKCZDE-ZTJXOPACSA-N |
| XLogP | 5.47 |
| TPSA | 113.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.89 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|