C24H26Cl2N4O2 — CID 12001097
3-[2-(2-chlorophenyl)-3-(4-chlorophenyl)-5,6,7,8-tetrahydrooxepino[3,2-c]pyrazol-8-yl]-1,1-diethylurea (PubChem CID 12001097) has the molecular formula C24H26Cl2N4O2 and a molecular weight of 473.40 g/mol. Its IUPAC name is 3-[2-(2-chlorophenyl)-3-(4-chlorophenyl)-5,6,7,8-tetrahydrooxepino[3,2-c]pyrazol-8-yl]-1,1-diethylurea.
| Compound Name | 3-[2-(2-chlorophenyl)-3-(4-chlorophenyl)-5,6,7,8-tetrahydrooxepino[3,2-c]pyrazol-8-yl]-1,1-diethylurea |
|---|---|
| PubChem CID | 12001097 |
| Molecular Formula | C24H26Cl2N4O2 |
| Molecular Weight | 473.40 g/mol |
| Exact Mass | 472.14 |
| IUPAC Name | 3-[2-(2-chlorophenyl)-3-(4-chlorophenyl)-5,6,7,8-tetrahydrooxepino[3,2-c]pyrazol-8-yl]-1,1-diethylurea |
| SMILES | CCN(CC)C(=O)NC1CCCOc2c1nn(-c1ccccc1Cl)c2-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C24H26Cl2N4O2/c1-3-29(4-2)24(31)27-19-9-7-15-32-23-21(19)28-30(20-10-6-5-8-18(20)26)22(23)16-11-13-17(25)14-12-16/h5-6,8,10-14,19H,3-4,7,9,15H2,1-2H3,(H,27,31) |
| InChIKey | SKYPBRGPOKTYGC-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.40 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |