C28H45N5O8S2 — CID 12001306
tert-butyl N-[4-[(1S,7R,10S,16E,21R)-3,6,9,19,22-pentaoxo-7-propan-2-yl-2-oxa-12,13-dithia-5,8,20,23-tetrazabicyclo[8.7.6]tricos-16-en-21-yl]butyl]carbamate (PubChem CID 12001306) has the molecular formula C28H45N5O8S2 and a molecular weight of 643.83 g/mol. Its IUPAC name is tert-butyl N-[4-[(1S,7R,10S,16E,21R)-3,6,9,19,22-pentaoxo-7-propan-2-yl-2-oxa-12,13-dithia-5,8,20,23-tetrazabicyclo[8.7.6]tricos-16-en-21-yl]butyl]carbamate.
| Compound Name | tert-butyl N-[4-[(1S,7R,10S,16E,21R)-3,6,9,19,22-pentaoxo-7-propan-2-yl-2-oxa-12,13-dithia-5,8,20,23-tetrazabicyclo[8.7.6]tricos-16-en-21-yl]butyl]carbamate |
|---|---|
| PubChem CID | 12001306 |
| Molecular Formula | C28H45N5O8S2 |
| Molecular Weight | 643.83 g/mol |
| Exact Mass | 643.27 |
| IUPAC Name | tert-butyl N-[4-[(1S,7R,10S,16E,21R)-3,6,9,19,22-pentaoxo-7-propan-2-yl-2-oxa-12,13-dithia-5,8,20,23-tetrazabicyclo[8.7.6]tricos-16-en-21-yl]butyl]carbamate |
| SMILES | CC(C)[C@H]1NC(=O)[C@H]2CSSCC/C=C/[C@H](CC(=O)N[C@H](CCCCNC(=O)OC(C)(C)C)C(=O)N2)OC(=O)CNC1=O |
| InChI | InChI=1S/C28H45N5O8S2/c1-17(2)23-26(38)30-15-22(35)40-18-10-7-9-13-42-43-16-20(25(37)33-23)32-24(36)19(31-21(34)14-18)11-6-8-12-29-27(39)41-28(3,4)5/h7,10,17-20,23H,6,8-9,11-16H2,1-5H3,(H,29,39)(H,30,38)(H,31,34)(H,32,36)(H,33,37)/b10-7+/t18-,19-,20-,23-/m1/s1 |
| InChIKey | LIYXGPVCRQXPIN-OWIQOLDVSA-N |
| XLogP | 1.56 |
| TPSA | 181.03 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.83 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|