About (6-chloro-1,2-benzoxazol-3-yl) 4-methylpiperidine-1-carboxylate
(6-chloro-1,2-benzoxazol-3-yl) 4-methylpiperidine-1-carboxylate (PubChem CID 12001416) has the molecular formula C14H15ClN2O3
and a molecular weight of 294.74 g/mol. Its IUPAC name is (6-chloro-1,2-benzoxazol-3-yl) 4-methylpiperidine-1-carboxylate.
Molecular Properties
| Compound Name | (6-chloro-1,2-benzoxazol-3-yl) 4-methylpiperidine-1-carboxylate |
| PubChem CID | 12001416 |
| Molecular Formula | C14H15ClN2O3 |
| Molecular Weight | 294.74 g/mol |
| Exact Mass | 294.08 |
| IUPAC Name | (6-chloro-1,2-benzoxazol-3-yl) 4-methylpiperidine-1-carboxylate |
| SMILES | CC1CCN(C(=O)Oc2noc3cc(Cl)ccc23)CC1 |
| InChI | InChI=1S/C14H15ClN2O3/c1-9-4-6-17(7-5-9)14(18)19-13-11-3-2-10(15)8-12(11)20-16-13/h2-3,8-9H,4-7H2,1H3 |
| InChIKey | RZXFNVAKZVSBDJ-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 55.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.74 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (6-chloro-1,2-benzoxazol-3-yl) 4-methylpiperidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6-chloro-1,2-benzoxazol-3-yl) 4-methylpiperidine-1-carboxylate?
The IUPAC name of (6-chloro-1,2-benzoxazol-3-yl) 4-methylpiperidine-1-carboxylate (CID 12001416) is (6-chloro-1,2-benzoxazol-3-yl) 4-methylpiperidine-1-carboxylate.
What is the SMILES notation for (6-chloro-1,2-benzoxazol-3-yl) 4-methylpiperidine-1-carboxylate?
The canonical SMILES for (6-chloro-1,2-benzoxazol-3-yl) 4-methylpiperidine-1-carboxylate is CC1CCN(C(=O)Oc2noc3cc(Cl)ccc23)CC1.
What is the InChIKey of (6-chloro-1,2-benzoxazol-3-yl) 4-methylpiperidine-1-carboxylate?
The InChIKey is RZXFNVAKZVSBDJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15ClN2O3/c1-9-4-6-17(7-5-9)14(18)19-13-11-3-2-10(15)8-12(11)20-16-13/h2-3,8-9H,4-7H2,1H3.
What are the key properties of (6-chloro-1,2-benzoxazol-3-yl) 4-methylpiperidine-1-carboxylate?
(6-chloro-1,2-benzoxazol-3-yl) 4-methylpiperidine-1-carboxylate has a molecular weight of 294.74 g/mol, XLogP of 3.71, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (6-chloro-1,2-benzoxazol-3-yl) 4-methylpiperidine-1-carboxylate is sourced from PubChem (CID 12001416), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).