About 2-(5-methoxy-1-propan-2-ylindol-3-yl)-1H-imidazo[4,5-f][1,10]phenanthroline
2-(5-methoxy-1-propan-2-ylindol-3-yl)-1H-imidazo[4,5-f][1,10]phenanthroline (PubChem CID 12001536) has the molecular formula C25H21N5O
and a molecular weight of 407.48 g/mol. Its IUPAC name is 2-(5-methoxy-1-propan-2-ylindol-3-yl)-1H-imidazo[4,5-f][1,10]phenanthroline.
Molecular Properties
| Compound Name | 2-(5-methoxy-1-propan-2-ylindol-3-yl)-1H-imidazo[4,5-f][1,10]phenanthroline |
| PubChem CID | 12001536 |
| Molecular Formula | C25H21N5O |
| Molecular Weight | 407.48 g/mol |
| Exact Mass | 407.17 |
| IUPAC Name | 2-(5-methoxy-1-propan-2-ylindol-3-yl)-1H-imidazo[4,5-f][1,10]phenanthroline |
| SMILES | COc1ccc2c(c1)c(-c1nc3c4cccnc4c4ncccc4c3[nH]1)cn2C(C)C |
| InChI | InChI=1S/C25H21N5O/c1-14(2)30-13-19(18-12-15(31-3)8-9-20(18)30)25-28-23-16-6-4-10-26-21(16)22-17(24(23)29-25)7-5-11-27-22/h4-14H,1-3H3,(H,28,29) |
| InChIKey | WYFNLLXXDCJPJQ-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 68.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 407.48 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 2-(5-methoxy-1-propan-2-ylindol-3-yl)-1H-imidazo[4,5-f][1,10]phenanthroline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(5-methoxy-1-propan-2-ylindol-3-yl)-1H-imidazo[4,5-f][1,10]phenanthroline?
The IUPAC name of 2-(5-methoxy-1-propan-2-ylindol-3-yl)-1H-imidazo[4,5-f][1,10]phenanthroline (CID 12001536) is 2-(5-methoxy-1-propan-2-ylindol-3-yl)-1H-imidazo[4,5-f][1,10]phenanthroline.
What is the SMILES notation for 2-(5-methoxy-1-propan-2-ylindol-3-yl)-1H-imidazo[4,5-f][1,10]phenanthroline?
The canonical SMILES for 2-(5-methoxy-1-propan-2-ylindol-3-yl)-1H-imidazo[4,5-f][1,10]phenanthroline is COc1ccc2c(c1)c(-c1nc3c4cccnc4c4ncccc4c3[nH]1)cn2C(C)C.
What is the InChIKey of 2-(5-methoxy-1-propan-2-ylindol-3-yl)-1H-imidazo[4,5-f][1,10]phenanthroline?
The InChIKey is WYFNLLXXDCJPJQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H21N5O/c1-14(2)30-13-19(18-12-15(31-3)8-9-20(18)30)25-28-23-16-6-4-10-26-21(16)22-17(24(23)29-25)7-5-11-27-22/h4-14H,1-3H3,(H,28,29).
What are the key properties of 2-(5-methoxy-1-propan-2-ylindol-3-yl)-1H-imidazo[4,5-f][1,10]phenanthroline?
2-(5-methoxy-1-propan-2-ylindol-3-yl)-1H-imidazo[4,5-f][1,10]phenanthroline has a molecular weight of 407.48 g/mol, XLogP of 5.87, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5-methoxy-1-propan-2-ylindol-3-yl)-1H-imidazo[4,5-f][1,10]phenanthroline is sourced from PubChem (CID 12001536), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).