About 4-[3-(1H-imidazo[4,5-f][1,10]phenanthrolin-2-yl)-1-methylindol-2-yl]morpholine
4-[3-(1H-imidazo[4,5-f][1,10]phenanthrolin-2-yl)-1-methylindol-2-yl]morpholine (PubChem CID 12001538) has the molecular formula C26H22N6O
and a molecular weight of 434.50 g/mol. Its IUPAC name is 4-[3-(1H-imidazo[4,5-f][1,10]phenanthrolin-2-yl)-1-methylindol-2-yl]morpholine.
Molecular Properties
| Compound Name | 4-[3-(1H-imidazo[4,5-f][1,10]phenanthrolin-2-yl)-1-methylindol-2-yl]morpholine |
| PubChem CID | 12001538 |
| Molecular Formula | C26H22N6O |
| Molecular Weight | 434.50 g/mol |
| Exact Mass | 434.19 |
| IUPAC Name | 4-[3-(1H-imidazo[4,5-f][1,10]phenanthrolin-2-yl)-1-methylindol-2-yl]morpholine |
| SMILES | Cn1c(N2CCOCC2)c(-c2nc3c4cccnc4c4ncccc4c3[nH]2)c2ccccc21 |
| InChI | InChI=1S/C26H22N6O/c1-31-19-9-3-2-6-16(19)20(26(31)32-12-14-33-15-13-32)25-29-23-17-7-4-10-27-21(17)22-18(24(23)30-25)8-5-11-28-22/h2-11H,12-15H2,1H3,(H,29,30) |
| InChIKey | FUPFLOJUJIFMCQ-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 71.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 434.50 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 4-[3-(1H-imidazo[4,5-f][1,10]phenanthrolin-2-yl)-1-methylindol-2-yl]morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[3-(1H-imidazo[4,5-f][1,10]phenanthrolin-2-yl)-1-methylindol-2-yl]morpholine?
The IUPAC name of 4-[3-(1H-imidazo[4,5-f][1,10]phenanthrolin-2-yl)-1-methylindol-2-yl]morpholine (CID 12001538) is 4-[3-(1H-imidazo[4,5-f][1,10]phenanthrolin-2-yl)-1-methylindol-2-yl]morpholine.
What is the SMILES notation for 4-[3-(1H-imidazo[4,5-f][1,10]phenanthrolin-2-yl)-1-methylindol-2-yl]morpholine?
The canonical SMILES for 4-[3-(1H-imidazo[4,5-f][1,10]phenanthrolin-2-yl)-1-methylindol-2-yl]morpholine is Cn1c(N2CCOCC2)c(-c2nc3c4cccnc4c4ncccc4c3[nH]2)c2ccccc21.
What is the InChIKey of 4-[3-(1H-imidazo[4,5-f][1,10]phenanthrolin-2-yl)-1-methylindol-2-yl]morpholine?
The InChIKey is FUPFLOJUJIFMCQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H22N6O/c1-31-19-9-3-2-6-16(19)20(26(31)32-12-14-33-15-13-32)25-29-23-17-7-4-10-27-21(17)22-18(24(23)30-25)8-5-11-28-22/h2-11H,12-15H2,1H3,(H,29,30).
What are the key properties of 4-[3-(1H-imidazo[4,5-f][1,10]phenanthrolin-2-yl)-1-methylindol-2-yl]morpholine?
4-[3-(1H-imidazo[4,5-f][1,10]phenanthrolin-2-yl)-1-methylindol-2-yl]morpholine has a molecular weight of 434.50 g/mol, XLogP of 4.65, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[3-(1H-imidazo[4,5-f][1,10]phenanthrolin-2-yl)-1-methylindol-2-yl]morpholine is sourced from PubChem (CID 12001538), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).