C28H30N6O — CID 12001598
2-[4-(3-benzyl-5-cyclohexyl-2-oxo-1,3,4-benzotriazepin-1-yl)phenyl]guanidine (PubChem CID 12001598) has the molecular formula C28H30N6O and a molecular weight of 466.59 g/mol. Its IUPAC name is 2-[4-(3-benzyl-5-cyclohexyl-2-oxo-1,3,4-benzotriazepin-1-yl)phenyl]guanidine.
| Compound Name | 2-[4-(3-benzyl-5-cyclohexyl-2-oxo-1,3,4-benzotriazepin-1-yl)phenyl]guanidine |
|---|---|
| PubChem CID | 12001598 |
| Molecular Formula | C28H30N6O |
| Molecular Weight | 466.59 g/mol |
| Exact Mass | 466.25 |
| IUPAC Name | 2-[4-(3-benzyl-5-cyclohexyl-2-oxo-1,3,4-benzotriazepin-1-yl)phenyl]guanidine |
| SMILES | NC(N)=Nc1ccc(N2C(=O)N(Cc3ccccc3)N=C(C3CCCCC3)c3ccccc32)cc1 |
| InChI | InChI=1S/C28H30N6O/c29-27(30)31-22-15-17-23(18-16-22)34-25-14-8-7-13-24(25)26(21-11-5-2-6-12-21)32-33(28(34)35)19-20-9-3-1-4-10-20/h1,3-4,7-10,13-18,21H,2,5-6,11-12,19H2,(H4,29,30,31) |
| InChIKey | GNLCKCYGLKJNPB-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 100.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.59 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|