C23H17ClN6O2S — CID 12001730
2-chloro-3-(1H-imidazo[4,5-f][1,10]phenanthrolin-2-yl)-N,N-dimethyl-1H-indole-5-sulfonamide (PubChem CID 12001730) has the molecular formula C23H17ClN6O2S and a molecular weight of 476.95 g/mol. Its IUPAC name is 2-chloro-3-(1H-imidazo[4,5-f][1,10]phenanthrolin-2-yl)-N,N-dimethyl-1H-indole-5-sulfonamide.
| Compound Name | 2-chloro-3-(1H-imidazo[4,5-f][1,10]phenanthrolin-2-yl)-N,N-dimethyl-1H-indole-5-sulfonamide |
|---|---|
| PubChem CID | 12001730 |
| Molecular Formula | C23H17ClN6O2S |
| Molecular Weight | 476.95 g/mol |
| Exact Mass | 476.08 |
| IUPAC Name | 2-chloro-3-(1H-imidazo[4,5-f][1,10]phenanthrolin-2-yl)-N,N-dimethyl-1H-indole-5-sulfonamide |
| SMILES | CN(C)S(=O)(=O)c1ccc2[nH]c(Cl)c(-c3nc4c5cccnc5c5ncccc5c4[nH]3)c2c1 |
| InChI | InChI=1S/C23H17ClN6O2S/c1-30(2)33(31,32)12-7-8-16-15(11-12)17(22(24)27-16)23-28-20-13-5-3-9-25-18(13)19-14(21(20)29-23)6-4-10-26-19/h3-11,27H,1-2H3,(H,28,29) |
| InChIKey | IQTUGEJXQPTUCC-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 107.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.95 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|