About calcium 4-(1-oxidopropylidene)-3,5-dioxocyclohexane-1-carboxylate
calcium 4-(1-oxidopropylidene)-3,5-dioxocyclohexane-1-carboxylate (PubChem CID 12001831) has the molecular formula C10H10CaO5
and a molecular weight of 250.26 g/mol. Its IUPAC name is calcium 4-(1-oxidopropylidene)-3,5-dioxocyclohexane-1-carboxylate.
Molecular Properties
| Compound Name | calcium 4-(1-oxidopropylidene)-3,5-dioxocyclohexane-1-carboxylate |
| PubChem CID | 12001831 |
| Molecular Formula | C10H10CaO5 |
| Molecular Weight | 250.26 g/mol |
| Exact Mass | 250.02 |
| IUPAC Name | calcium 4-(1-oxidopropylidene)-3,5-dioxocyclohexane-1-carboxylate |
| SMILES | CCC([O-])=C1C(=O)CC(C(=O)[O-])CC1=O.[Ca+2] |
| InChI | InChI=1S/C10H12O5.Ca/c1-2-6(11)9-7(12)3-5(10(14)15)4-8(9)13;/h5,11H,2-4H2,1H3,(H,14,15);/q;+2/p-2/b9-6-; |
| InChIKey | NLKUPINTOLSSLD-BORNJIKYSA-L |
| XLogP | -2.07 |
| TPSA | 97.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.26 |
| LogP ≤ 5 | -2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|
Analyze calcium 4-(1-oxidopropylidene)-3,5-dioxocyclohexane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of calcium 4-(1-oxidopropylidene)-3,5-dioxocyclohexane-1-carboxylate?
The IUPAC name of calcium 4-(1-oxidopropylidene)-3,5-dioxocyclohexane-1-carboxylate (CID 12001831) is calcium 4-(1-oxidopropylidene)-3,5-dioxocyclohexane-1-carboxylate.
What is the SMILES notation for calcium 4-(1-oxidopropylidene)-3,5-dioxocyclohexane-1-carboxylate?
The canonical SMILES for calcium 4-(1-oxidopropylidene)-3,5-dioxocyclohexane-1-carboxylate is CCC([O-])=C1C(=O)CC(C(=O)[O-])CC1=O.[Ca+2].
What is the InChIKey of calcium 4-(1-oxidopropylidene)-3,5-dioxocyclohexane-1-carboxylate?
The InChIKey is NLKUPINTOLSSLD-BORNJIKYSA-L. The full InChI is InChI=1S/C10H12O5.Ca/c1-2-6(11)9-7(12)3-5(10(14)15)4-8(9)13;/h5,11H,2-4H2,1H3,(H,14,15);/q;+2/p-2/b9-6-;.
What are the key properties of calcium 4-(1-oxidopropylidene)-3,5-dioxocyclohexane-1-carboxylate?
calcium 4-(1-oxidopropylidene)-3,5-dioxocyclohexane-1-carboxylate has a molecular weight of 250.26 g/mol, XLogP of -2.07, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for calcium 4-(1-oxidopropylidene)-3,5-dioxocyclohexane-1-carboxylate is sourced from PubChem (CID 12001831), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).