C25H35N7O7S — CID 12001938
(2S)-2-[[(2S)-2-[[2-[[(2S)-2-[[(2S)-2-amino-3-hydroxypropanoyl]amino]-3-phenylpropanoyl]amino]acetyl]amino]-4-methylsulfanylbutanoyl]amino]-3-(1H-imidazol-5-yl)propanoic acid (PubChem CID 12001938) has the molecular formula C25H35N7O7S and a molecular weight of 577.66 g/mol. Its IUPAC name is (2S)-2-[[(2S)-2-[[2-[[(2S)-2-[[(2S)-2-amino-3-hydroxypropanoyl]amino]-3-phenylpropanoyl]amino]acetyl]amino]-4-methylsulfanylbutanoyl]amino]-3-(1H-imidazol-5-yl)propanoic acid.
| Compound Name | (2S)-2-[[(2S)-2-[[2-[[(2S)-2-[[(2S)-2-amino-3-hydroxypropanoyl]amino]-3-phenylpropanoyl]amino]acetyl]amino]-4-methylsulfanylbutanoyl]amino]-3-(1H-imidazol-5-yl)propanoic acid |
|---|---|
| PubChem CID | 12001938 |
| Molecular Formula | C25H35N7O7S |
| Molecular Weight | 577.66 g/mol |
| Exact Mass | 577.23 |
| IUPAC Name | (2S)-2-[[(2S)-2-[[2-[[(2S)-2-[[(2S)-2-amino-3-hydroxypropanoyl]amino]-3-phenylpropanoyl]amino]acetyl]amino]-4-methylsulfanylbutanoyl]amino]-3-(1H-imidazol-5-yl)propanoic acid |
| SMILES | CSCC[C@H](NC(=O)CNC(=O)[C@H](Cc1ccccc1)NC(=O)[C@@H](N)CO)C(=O)N[C@@H](Cc1cnc[nH]1)C(=O)O |
| InChI | InChI=1S/C25H35N7O7S/c1-40-8-7-18(24(37)32-20(25(38)39)10-16-11-27-14-29-16)30-21(34)12-28-23(36)19(31-22(35)17(26)13-33)9-15-5-3-2-4-6-15/h2-6,11,14,17-20,33H,7-10,12-13,26H2,1H3,(H,27,29)(H,28,36)(H,30,34)(H,31,35)(H,32,37)(H,38,39)/t17-,18-,19-,20-/m0/s1 |
| InChIKey | USEDIFIUHJMSII-MUGJNUQGSA-N |
| XLogP | -2.08 |
| TPSA | 228.63 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.66 |
| LogP ≤ 5 | -2.08 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 9 |