C36H39Cl3F3N3O4 — CID 12001952
(3R,4S)-N-[[2-chloro-5-[2-(3,3,3-trifluoropropanoylamino)ethyl]phenyl]methyl]-N-cyclopropyl-4-[4-[2-(2,6-dichloro-4-methylphenoxy)ethoxy]phenyl]piperidine-3-carboxamide (PubChem CID 12001952) has the molecular formula C36H39Cl3F3N3O4 and a molecular weight of 741.08 g/mol. Its IUPAC name is (3R,4S)-N-[[2-chloro-5-[2-(3,3,3-trifluoropropanoylamino)ethyl]phenyl]methyl]-N-cyclopropyl-4-[4-[2-(2,6-dichloro-4-methylphenoxy)ethoxy]phenyl]piperidine-3-carboxamide.
| Compound Name | (3R,4S)-N-[[2-chloro-5-[2-(3,3,3-trifluoropropanoylamino)ethyl]phenyl]methyl]-N-cyclopropyl-4-[4-[2-(2,6-dichloro-4-methylphenoxy)ethoxy]phenyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 12001952 |
| Molecular Formula | C36H39Cl3F3N3O4 |
| Molecular Weight | 741.08 g/mol |
| Exact Mass | 739.20 |
| IUPAC Name | (3R,4S)-N-[[2-chloro-5-[2-(3,3,3-trifluoropropanoylamino)ethyl]phenyl]methyl]-N-cyclopropyl-4-[4-[2-(2,6-dichloro-4-methylphenoxy)ethoxy]phenyl]piperidine-3-carboxamide |
| SMILES | Cc1cc(Cl)c(OCCOc2ccc([C@H]3CCNC[C@@H]3C(=O)N(Cc3cc(CCNC(=O)CC(F)(F)F)ccc3Cl)C3CC3)cc2)c(Cl)c1 |
| InChI | InChI=1S/C36H39Cl3F3N3O4/c1-22-16-31(38)34(32(39)17-22)49-15-14-48-27-7-3-24(4-8-27)28-11-12-43-20-29(28)35(47)45(26-5-6-26)21-25-18-23(2-9-30(25)37)10-13-44-33(46)19-36(40,41)42/h2-4,7-9,16-18,26,28-29,43H,5-6,10-15,19-21H2,1H3,(H,44,46)/t28-,29+/m1/s1 |
| InChIKey | VETZEDDIBGTLQT-WDYNHAJCSA-N |
| XLogP | 7.91 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 741.08 |
| LogP ≤ 5 | 7.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|