About [(3S)-7-chloro-5-[2-(trifluoromethyl)phenyl]-2,3-dihydro-1,4-benzodioxin-3-yl]methanamine
[(3S)-7-chloro-5-[2-(trifluoromethyl)phenyl]-2,3-dihydro-1,4-benzodioxin-3-yl]methanamine (PubChem CID 12002091) has the molecular formula C16H13ClF3NO2
and a molecular weight of 343.73 g/mol. Its IUPAC name is [(3S)-7-chloro-5-[2-(trifluoromethyl)phenyl]-2,3-dihydro-1,4-benzodioxin-3-yl]methanamine.
Molecular Properties
| Compound Name | [(3S)-7-chloro-5-[2-(trifluoromethyl)phenyl]-2,3-dihydro-1,4-benzodioxin-3-yl]methanamine |
| PubChem CID | 12002091 |
| Molecular Formula | C16H13ClF3NO2 |
| Molecular Weight | 343.73 g/mol |
| Exact Mass | 343.06 |
| IUPAC Name | [(3S)-7-chloro-5-[2-(trifluoromethyl)phenyl]-2,3-dihydro-1,4-benzodioxin-3-yl]methanamine |
| SMILES | NC[C@H]1COc2cc(Cl)cc(-c3ccccc3C(F)(F)F)c2O1 |
| InChI | InChI=1S/C16H13ClF3NO2/c17-9-5-12(11-3-1-2-4-13(11)16(18,19)20)15-14(6-9)22-8-10(7-21)23-15/h1-6,10H,7-8,21H2/t10-/m0/s1 |
| InChIKey | INTPSDAPJYBXNM-JTQLQIEISA-N |
| XLogP | 4.12 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 343.73 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [(3S)-7-chloro-5-[2-(trifluoromethyl)phenyl]-2,3-dihydro-1,4-benzodioxin-3-yl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3S)-7-chloro-5-[2-(trifluoromethyl)phenyl]-2,3-dihydro-1,4-benzodioxin-3-yl]methanamine?
The IUPAC name of [(3S)-7-chloro-5-[2-(trifluoromethyl)phenyl]-2,3-dihydro-1,4-benzodioxin-3-yl]methanamine (CID 12002091) is [(3S)-7-chloro-5-[2-(trifluoromethyl)phenyl]-2,3-dihydro-1,4-benzodioxin-3-yl]methanamine.
What is the SMILES notation for [(3S)-7-chloro-5-[2-(trifluoromethyl)phenyl]-2,3-dihydro-1,4-benzodioxin-3-yl]methanamine?
The canonical SMILES for [(3S)-7-chloro-5-[2-(trifluoromethyl)phenyl]-2,3-dihydro-1,4-benzodioxin-3-yl]methanamine is NC[C@H]1COc2cc(Cl)cc(-c3ccccc3C(F)(F)F)c2O1.
What is the InChIKey of [(3S)-7-chloro-5-[2-(trifluoromethyl)phenyl]-2,3-dihydro-1,4-benzodioxin-3-yl]methanamine?
The InChIKey is INTPSDAPJYBXNM-JTQLQIEISA-N. The full InChI is InChI=1S/C16H13ClF3NO2/c17-9-5-12(11-3-1-2-4-13(11)16(18,19)20)15-14(6-9)22-8-10(7-21)23-15/h1-6,10H,7-8,21H2/t10-/m0/s1.
What are the key properties of [(3S)-7-chloro-5-[2-(trifluoromethyl)phenyl]-2,3-dihydro-1,4-benzodioxin-3-yl]methanamine?
[(3S)-7-chloro-5-[2-(trifluoromethyl)phenyl]-2,3-dihydro-1,4-benzodioxin-3-yl]methanamine has a molecular weight of 343.73 g/mol, XLogP of 4.12, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(3S)-7-chloro-5-[2-(trifluoromethyl)phenyl]-2,3-dihydro-1,4-benzodioxin-3-yl]methanamine is sourced from PubChem (CID 12002091), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).