C30H36FNO4 — CID 12002203
3-[4-[[3-[4-(2-ethoxyethoxy)-2,3,5,6-tetramethylphenyl]phenyl]methylamino]-2-fluorophenyl]propanoic acid (PubChem CID 12002203) has the molecular formula C30H36FNO4 and a molecular weight of 493.62 g/mol. Its IUPAC name is 3-[4-[[3-[4-(2-ethoxyethoxy)-2,3,5,6-tetramethylphenyl]phenyl]methylamino]-2-fluorophenyl]propanoic acid.
| Compound Name | 3-[4-[[3-[4-(2-ethoxyethoxy)-2,3,5,6-tetramethylphenyl]phenyl]methylamino]-2-fluorophenyl]propanoic acid |
|---|---|
| PubChem CID | 12002203 |
| Molecular Formula | C30H36FNO4 |
| Molecular Weight | 493.62 g/mol |
| Exact Mass | 493.26 |
| IUPAC Name | 3-[4-[[3-[4-(2-ethoxyethoxy)-2,3,5,6-tetramethylphenyl]phenyl]methylamino]-2-fluorophenyl]propanoic acid |
| SMILES | CCOCCOc1c(C)c(C)c(-c2cccc(CNc3ccc(CCC(=O)O)c(F)c3)c2)c(C)c1C |
| InChI | InChI=1S/C30H36FNO4/c1-6-35-14-15-36-30-21(4)19(2)29(20(3)22(30)5)25-9-7-8-23(16-25)18-32-26-12-10-24(27(31)17-26)11-13-28(33)34/h7-10,12,16-17,32H,6,11,13-15,18H2,1-5H3,(H,33,34) |
| InChIKey | IUHUDYJFXPWQJR-UHFFFAOYSA-N |
| XLogP | 6.77 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.62 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|