C20H15FN2O5S — CID 12002244
(5E)-5-[[3-fluoro-4-[4-[(2-oxo-1,3-oxazolidin-4-yl)methyl]phenoxy]phenyl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 12002244) has the molecular formula C20H15FN2O5S and a molecular weight of 414.41 g/mol. Its IUPAC name is (5E)-5-[[3-fluoro-4-[4-[(2-oxo-1,3-oxazolidin-4-yl)methyl]phenoxy]phenyl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5E)-5-[[3-fluoro-4-[4-[(2-oxo-1,3-oxazolidin-4-yl)methyl]phenoxy]phenyl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 12002244 |
| Molecular Formula | C20H15FN2O5S |
| Molecular Weight | 414.41 g/mol |
| Exact Mass | 414.07 |
| IUPAC Name | (5E)-5-[[3-fluoro-4-[4-[(2-oxo-1,3-oxazolidin-4-yl)methyl]phenoxy]phenyl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1NC(Cc2ccc(Oc3ccc(/C=C4/SC(=O)NC4=O)cc3F)cc2)CO1 |
| InChI | InChI=1S/C20H15FN2O5S/c21-15-8-12(9-17-18(24)23-20(26)29-17)3-6-16(15)28-14-4-1-11(2-5-14)7-13-10-27-19(25)22-13/h1-6,8-9,13H,7,10H2,(H,22,25)(H,23,24,26)/b17-9+ |
| InChIKey | KITYRWCBPQIWLN-RQZCQDPDSA-N |
| XLogP | 3.59 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.41 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|