C21H17FN2O5S — CID 12002348
(5E)-5-[[3-fluoro-4-[4-[(3-methyl-2-oxo-1,3-oxazolidin-4-yl)methyl]phenoxy]phenyl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 12002348) has the molecular formula C21H17FN2O5S and a molecular weight of 428.44 g/mol. Its IUPAC name is (5E)-5-[[3-fluoro-4-[4-[(3-methyl-2-oxo-1,3-oxazolidin-4-yl)methyl]phenoxy]phenyl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5E)-5-[[3-fluoro-4-[4-[(3-methyl-2-oxo-1,3-oxazolidin-4-yl)methyl]phenoxy]phenyl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 12002348 |
| Molecular Formula | C21H17FN2O5S |
| Molecular Weight | 428.44 g/mol |
| Exact Mass | 428.08 |
| IUPAC Name | (5E)-5-[[3-fluoro-4-[4-[(3-methyl-2-oxo-1,3-oxazolidin-4-yl)methyl]phenoxy]phenyl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | CN1C(=O)OCC1Cc1ccc(Oc2ccc(/C=C3/SC(=O)NC3=O)cc2F)cc1 |
| InChI | InChI=1S/C21H17FN2O5S/c1-24-14(11-28-21(24)27)8-12-2-5-15(6-3-12)29-17-7-4-13(9-16(17)22)10-18-19(25)23-20(26)30-18/h2-7,9-10,14H,8,11H2,1H3,(H,23,25,26)/b18-10+ |
| InChIKey | IJUNYOYRROVPDG-VCHYOVAHSA-N |
| XLogP | 3.93 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.44 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|