C24H19F3N2O6S2 — CID 12002380
2-[(5E)-5-[[4-[4-[(3-methyl-2-oxo-1,3-oxazolidin-4-yl)methyl]phenoxy]-3-(trifluoromethyl)phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetic acid (PubChem CID 12002380) has the molecular formula C24H19F3N2O6S2 and a molecular weight of 552.55 g/mol. Its IUPAC name is 2-[(5E)-5-[[4-[4-[(3-methyl-2-oxo-1,3-oxazolidin-4-yl)methyl]phenoxy]-3-(trifluoromethyl)phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetic acid.
| Compound Name | 2-[(5E)-5-[[4-[4-[(3-methyl-2-oxo-1,3-oxazolidin-4-yl)methyl]phenoxy]-3-(trifluoromethyl)phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetic acid |
|---|---|
| PubChem CID | 12002380 |
| Molecular Formula | C24H19F3N2O6S2 |
| Molecular Weight | 552.55 g/mol |
| Exact Mass | 552.06 |
| IUPAC Name | 2-[(5E)-5-[[4-[4-[(3-methyl-2-oxo-1,3-oxazolidin-4-yl)methyl]phenoxy]-3-(trifluoromethyl)phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetic acid |
| SMILES | CN1C(=O)OCC1Cc1ccc(Oc2ccc(/C=C3/SC(=S)N(CC(=O)O)C3=O)cc2C(F)(F)F)cc1 |
| InChI | InChI=1S/C24H19F3N2O6S2/c1-28-15(12-34-22(28)33)8-13-2-5-16(6-3-13)35-18-7-4-14(9-17(18)24(25,26)27)10-19-21(32)29(11-20(30)31)23(36)37-19/h2-7,9-10,15H,8,11-12H2,1H3,(H,30,31)/b19-10+ |
| InChIKey | DPPOPIQATJXWON-VXLYETTFSA-N |
| XLogP | 4.78 |
| TPSA | 96.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.55 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|