C25H21F3N2O6S2 — CID 12002408
2-[(5E)-5-[[4-[4-[(3-ethyl-2-oxo-1,3-oxazolidin-4-yl)methyl]phenoxy]-3-(trifluoromethyl)phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetic acid (PubChem CID 12002408) has the molecular formula C25H21F3N2O6S2 and a molecular weight of 566.58 g/mol. Its IUPAC name is 2-[(5E)-5-[[4-[4-[(3-ethyl-2-oxo-1,3-oxazolidin-4-yl)methyl]phenoxy]-3-(trifluoromethyl)phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetic acid.
| Compound Name | 2-[(5E)-5-[[4-[4-[(3-ethyl-2-oxo-1,3-oxazolidin-4-yl)methyl]phenoxy]-3-(trifluoromethyl)phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetic acid |
|---|---|
| PubChem CID | 12002408 |
| Molecular Formula | C25H21F3N2O6S2 |
| Molecular Weight | 566.58 g/mol |
| Exact Mass | 566.08 |
| IUPAC Name | 2-[(5E)-5-[[4-[4-[(3-ethyl-2-oxo-1,3-oxazolidin-4-yl)methyl]phenoxy]-3-(trifluoromethyl)phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetic acid |
| SMILES | CCN1C(=O)OCC1Cc1ccc(Oc2ccc(/C=C3/SC(=S)N(CC(=O)O)C3=O)cc2C(F)(F)F)cc1 |
| InChI | InChI=1S/C25H21F3N2O6S2/c1-2-29-16(13-35-23(29)34)9-14-3-6-17(7-4-14)36-19-8-5-15(10-18(19)25(26,27)28)11-20-22(33)30(12-21(31)32)24(37)38-20/h3-8,10-11,16H,2,9,12-13H2,1H3,(H,31,32)/b20-11+ |
| InChIKey | ITDCZRKYLVNLRL-RGVLZGJSSA-N |
| XLogP | 5.17 |
| TPSA | 96.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.58 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|